(1'R,4'S)-9-[4-({[N-[(D-Biotinoyl)sulfamoyl]amino}methyl)-cyclopent-2'-en-1'-yl]adenine Triethylammonium Salt

ID: ALA4299215

PubChem CID: 145948826

Max Phase: Preclinical

Molecular Formula: C27H44N10O4S2

Molecular Weight: 535.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)CC.Nc1ncnc2c1ncn2[C@H]1C=C[C@@H](CNS(=O)(=O)NC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)C1

Standard InChI:  InChI=1S/C21H29N9O4S2.C6H15N/c22-19-18-20(24-10-23-19)30(11-25-18)13-6-5-12(7-13)8-26-36(33,34)29-16(31)4-2-1-3-15-17-14(9-35-15)27-21(32)28-17;1-4-7(5-2)6-3/h5-6,10-15,17,26H,1-4,7-9H2,(H,29,31)(H2,22,23,24)(H2,27,28,32);4-6H2,1-3H3/t12-,13+,14+,15+,17+;/m1./s1

Standard InChI Key:  IDDXQXSTXYOVOT-LIQRJVTDSA-N

Molfile:  

     RDKit          2D

 45 48  0  0  0  0  0  0  0  0999 V2000
    8.6532    6.3783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3532    7.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9532    7.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6563    4.8775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3138    6.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9926    6.5286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6964    4.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.0049   10.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5183   10.3727    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7275   11.3963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3364   11.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6876   12.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0476   14.2712    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3208   12.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5046   13.9701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5163    9.0134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8332   12.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5920   12.9204    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4312   11.4527    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2600   11.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7723   11.1683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1991    9.7812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7115    9.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1383    8.1960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9798   10.5343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6506    7.9979    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0774    6.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083    9.1072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0810    8.9491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4102    6.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9824    5.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4400    4.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5533    3.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1749    2.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1949    3.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9991   -2.7132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  1  0
  2  5  1  0
  3  6  1  0
  4  7  1  0
  9  8  1  0
 10  8  1  0
 11  9  1  0
 12 10  1  0
 13 15  1  0
 14 11  1  0
 15 12  1  0
 16  8  2  0
 14 17  1  1
 12 18  1  6
 11 19  1  6
 12 11  1  0
 13 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 26 28  2  0
 26 29  2  0
 27 30  1  0
 31 30  1  6
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  1  0
 35 31  1  0
 34 36  1  6
 36 40  1  0
 39 37  1  0
 37 38  2  0
 38 36  1  0
 39 40  2  0
 39 44  1  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
M  END

Associated Targets(non-human)

birA Biotin--acetyl-CoA-carboxylase ligase (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 535.66Molecular Weight (Monoisotopic): 535.1784AlogP: 0.20#Rotatable Bonds: 10
Polar Surface Area: 186.02Molecular Species: ACIDHBA: 10HBD: 5
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 4.10CX Basic pKa: 5.14CX LogP: -1.51CX LogD: -1.89
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.16Np Likeness Score: -0.15

References

1. Bockman MR, Kalinda AS, Petrelli R, De la Mora-Rey T, Tiwari D, Liu F, Dawadi S, Nandakumar M, Rhee KY, Schnappinger D, Finzel BC, Aldrich CC..  (2015)  Targeting Mycobacterium tuberculosis Biotin Protein Ligase (MtBPL) with Nucleoside-Based Bisubstrate Adenylation Inhibitors.,  58  (18): [PMID:26299766] [10.1021/acs.jmedchem.5b00719]

Source