The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-[({N-[D-Biotinoyl))sulfamoyl]amino}ethoxy)methyl]adenine Triethylammonium Salt ID: ALA4299216
PubChem CID: 145948827
Max Phase: Preclinical
Molecular Formula: C24H42N10O5S2
Molecular Weight: 513.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CC.Nc1ncnc2c1ncn2COCCNS(=O)(=O)NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21
Standard InChI: InChI=1S/C18H27N9O5S2.C6H15N/c19-16-15-17(21-8-20-16)27(9-22-15)10-32-6-5-23-34(30,31)26-13(28)4-2-1-3-12-14-11(7-33-12)24-18(29)25-14;1-4-7(5-2)6-3/h8-9,11-12,14,23H,1-7,10H2,(H,26,28)(H2,19,20,21)(H2,24,25,29);4-6H2,1-3H3/t11-,12-,14-;/m0./s1
Standard InChI Key: HQYBZLSGRWPAIS-RGESYUBESA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
20.3340 7.7797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0341 8.5297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6340 8.5297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3371 6.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9946 7.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6735 7.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3772 5.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4928 16.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4886 14.6842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9009 16.6675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9344 14.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7883 15.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2341 13.5049 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.8033 13.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2059 14.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5197 16.8980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3351 11.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3741 16.2542 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.3503 13.4170 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.8663 11.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3981 9.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9293 9.5644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4611 8.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9923 7.8301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2615 7.2445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5241 6.4042 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.0553 6.0958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6986 6.6502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3245 5.5101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5870 4.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1182 4.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 -2.7132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
2 5 1 0
3 6 1 0
4 7 1 0
9 8 1 0
10 8 1 0
11 9 1 0
12 10 1 0
13 15 1 0
14 11 1 0
15 12 1 0
16 8 2 0
14 17 1 1
12 18 1 6
11 19 1 6
12 11 1 0
13 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
26 28 2 0
26 29 2 0
27 30 1 0
31 30 1 0
32 33 1 0
33 31 1 0
32 34 1 0
34 38 1 0
37 35 1 0
35 36 2 0
36 34 1 0
37 38 2 0
37 42 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.61Molecular Weight (Monoisotopic): 513.1577AlogP: -0.94#Rotatable Bonds: 12Polar Surface Area: 195.25Molecular Species: ACIDHBA: 11HBD: 5#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 4.14CX Basic pKa: 5.02CX LogP: -2.14CX LogD: -2.59Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.17Np Likeness Score: -0.77
References 1. Bockman MR, Kalinda AS, Petrelli R, De la Mora-Rey T, Tiwari D, Liu F, Dawadi S, Nandakumar M, Rhee KY, Schnappinger D, Finzel BC, Aldrich CC.. (2015) Targeting Mycobacterium tuberculosis Biotin Protein Ligase (MtBPL) with Nucleoside-Based Bisubstrate Adenylation Inhibitors., 58 (18): [PMID:26299766 ] [10.1021/acs.jmedchem.5b00719 ]