The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-{5'-O-[N-(D-Biotinoyl)sulfamoyl]-2'-deoxy-2'-fluoro-beta-Darabinofuranosyl}adenine Triethylammonium Salt ID: ALA4299217
PubChem CID: 145948828
Max Phase: Preclinical
Molecular Formula: C26H42FN9O7S2
Molecular Weight: 574.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CC.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)[C@@H](O)[C@@H]1F
Standard InChI: InChI=1S/C20H27FN8O7S2.C6H15N/c21-13-16(31)10(36-19(13)29-8-25-15-17(22)23-7-24-18(15)29)5-35-38(33,34)28-12(30)4-2-1-3-11-14-9(6-37-11)26-20(32)27-14;1-4-7(5-2)6-3/h7-11,13-14,16,19,31H,1-6H2,(H,28,30)(H2,22,23,24)(H2,26,27,32);4-6H2,1-3H3/t9-,10+,11-,13-,14-,16+,19+;/m0./s1
Standard InChI Key: IWCLDGVWUQUCIU-GEJZKSIJSA-N
Molfile:
RDKit 2D
47 50 0 0 0 0 0 0 0 0999 V2000
24.3155 -3.8367 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.7399 3.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2265 3.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0174 5.0180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4084 5.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0572 6.1153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6972 7.8929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.4240 6.5733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2402 7.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2285 2.6351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9117 6.3752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1528 6.5421 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.3136 5.0744 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.4848 4.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9725 4.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5457 3.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0334 3.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6065 1.8177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7650 4.1560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0942 1.6196 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.6674 0.2326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6365 2.7289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8258 2.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1551 0.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7272 -1.3502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1848 -1.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2981 -3.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9197 -3.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9398 -2.6269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4586 -5.1750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4586 -7.5816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3337 -6.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0365 -7.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0365 -5.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7421 -4.8650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4294 -5.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4294 -7.1258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7421 -7.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7457 -9.0915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0995 -0.9280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6031 -1.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2606 0.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9394 0.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6432 -2.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 2 1 0
5 3 1 0
6 4 1 0
7 9 1 0
8 5 1 0
9 6 1 0
10 2 2 0
8 11 1 1
6 12 1 6
5 13 1 6
6 5 1 0
7 8 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 1 0
20 22 2 0
20 23 2 0
21 24 1 0
25 24 1 6
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 25 1 0
28 30 1 6
30 34 1 0
33 31 1 0
31 32 2 0
32 30 1 0
33 34 2 0
33 38 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
26 40 1 1
27 1 1 6
41 42 1 0
41 43 1 0
41 44 1 0
42 45 1 0
43 46 1 0
44 47 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.62Molecular Weight (Monoisotopic): 574.1428AlogP: -0.89#Rotatable Bonds: 10Polar Surface Area: 212.68Molecular Species: ACIDHBA: 13HBD: 5#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.05CX Basic pKa: 4.92CX LogP: -2.37CX LogD: -2.13Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.17Np Likeness Score: 0.14
References 1. Bockman MR, Kalinda AS, Petrelli R, De la Mora-Rey T, Tiwari D, Liu F, Dawadi S, Nandakumar M, Rhee KY, Schnappinger D, Finzel BC, Aldrich CC.. (2015) Targeting Mycobacterium tuberculosis Biotin Protein Ligase (MtBPL) with Nucleoside-Based Bisubstrate Adenylation Inhibitors., 58 (18): [PMID:26299766 ] [10.1021/acs.jmedchem.5b00719 ]