The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-(Hydroxy(((2R,3R)-2-((oleoyloxy)methyl)tetrahydro-2H-pyran-3-yl)oxy)phosphoryl)-L-serine ID: ALA4299633
PubChem CID: 145948820
Max Phase: Preclinical
Molecular Formula: C27H50NO9P
Molecular Weight: 563.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H]1OCCC[C@@H]1OP(=O)(O)OC[C@@H](N)C(=O)O
Standard InChI: InChI=1S/C27H50NO9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-26(29)35-22-25-24(18-17-20-34-25)37-38(32,33)36-21-23(28)27(30)31/h9-10,23-25H,2-8,11-22,28H2,1H3,(H,30,31)(H,32,33)/b10-9-/t23-,24+,25+/m1/s1
Standard InChI Key: VWKCFDZBVNFTLU-LGVZBDMTSA-N
Molfile:
RDKit 2D
38 38 0 0 0 0 0 0 0 0999 V2000
-1.7486 -5.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7450 -6.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6092 -7.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4770 -6.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4806 -5.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6164 -5.0126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8844 -5.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8880 -4.0064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8772 -7.0062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8736 -8.0062 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-0.8700 -9.0062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1264 -8.0026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8736 -8.0098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0022 -9.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0014 -10.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8692 -11.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8728 -11.9998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7334 -10.4968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8628 -11.0062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0238 -3.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0274 -2.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8440 -4.0002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8368 -2.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8332 -1.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6974 -0.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6938 0.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5580 1.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5544 2.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4186 2.5090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4150 3.5090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5472 4.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5436 5.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6758 5.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6720 6.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8042 6.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8006 7.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0672 8.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0708 9.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 1
7 8 1 0
2 9 1 1
9 10 1 0
10 11 1 0
10 12 2 0
10 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
15 19 1 6
8 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.67Molecular Weight (Monoisotopic): 563.3223AlogP: 5.66#Rotatable Bonds: 23Polar Surface Area: 154.61Molecular Species: ZWITTERIONHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.49CX Basic pKa: 9.38CX LogP: 4.25CX LogD: 1.23Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.06Np Likeness Score: 0.99
References 1. Jung S, Inoue A, Nakamura S, Kishi T, Uwamizu A, Sayama M, Ikubo M, Otani Y, Kano K, Makide K, Aoki J, Ohwada T.. (2016) Conformational Constraint of the Glycerol Moiety of Lysophosphatidylserine Affords Compounds with Receptor Subtype Selectivity., 59 (8): [PMID:27077565 ] [10.1021/acs.jmedchem.5b01925 ]