O-(Hydroxy(((2R,3R)-2-((oleoyloxy)methyl)tetrahydro-2H-pyran-3-yl)oxy)phosphoryl)-L-serine

ID: ALA4299633

PubChem CID: 145948820

Max Phase: Preclinical

Molecular Formula: C27H50NO9P

Molecular Weight: 563.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H]1OCCC[C@@H]1OP(=O)(O)OC[C@@H](N)C(=O)O

Standard InChI:  InChI=1S/C27H50NO9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-26(29)35-22-25-24(18-17-20-34-25)37-38(32,33)36-21-23(28)27(30)31/h9-10,23-25H,2-8,11-22,28H2,1H3,(H,30,31)(H,32,33)/b10-9-/t23-,24+,25+/m1/s1

Standard InChI Key:  VWKCFDZBVNFTLU-LGVZBDMTSA-N

Molfile:  

     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
   -1.7486   -5.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7450   -6.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6092   -7.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4770   -6.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4806   -5.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6164   -5.0126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8844   -5.0064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8880   -4.0064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8772   -7.0062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8736   -8.0062    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8700   -9.0062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1264   -8.0026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8736   -8.0098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0022   -9.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0014  -10.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8692  -11.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8728  -11.9998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7334  -10.4968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8628  -11.0062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0238   -3.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0274   -2.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8440   -4.0002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8368   -2.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8332   -1.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6974   -0.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6938    0.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5580    1.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5544    2.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4186    2.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4150    3.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5472    4.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5436    5.0058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6758    5.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6720    6.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8042    6.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8006    7.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0672    8.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0708    9.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  1  1
  7  8  1  0
  2  9  1  1
  9 10  1  0
 10 11  1  0
 10 12  2  0
 10 13  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 15 19  1  6
  8 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4299633

    ---

Associated Targets(non-human)

P2ry10 Putative P2Y purinoceptor 10 (276 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Gpr34 G protein-coupled receptor 34 (411 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Gpr174 Probable G-protein coupled receptor 174 (140 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 563.67Molecular Weight (Monoisotopic): 563.3223AlogP: 5.66#Rotatable Bonds: 23
Polar Surface Area: 154.61Molecular Species: ZWITTERIONHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.49CX Basic pKa: 9.38CX LogP: 4.25CX LogD: 1.23
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.06Np Likeness Score: 0.99

References

1. Jung S, Inoue A, Nakamura S, Kishi T, Uwamizu A, Sayama M, Ikubo M, Otani Y, Kano K, Makide K, Aoki J, Ohwada T..  (2016)  Conformational Constraint of the Glycerol Moiety of Lysophosphatidylserine Affords Compounds with Receptor Subtype Selectivity.,  59  (8): [PMID:27077565] [10.1021/acs.jmedchem.5b01925]

Source