(4-Isothiocyanato-naphthalen-1-yl)-[2-methyl-1-(2-morpholin-4-yl-ethyl)-1H-indol-3-yl]-methanone

ID: ALA431950

PubChem CID: 10647431

Max Phase: Preclinical

Molecular Formula: C27H25N3O2S

Molecular Weight: 455.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C(=O)c2ccc(N=C=S)c3ccccc23)c2ccccc2n1CCN1CCOCC1

Standard InChI:  InChI=1S/C27H25N3O2S/c1-19-26(27(31)22-10-11-24(28-18-33)21-7-3-2-6-20(21)22)23-8-4-5-9-25(23)30(19)13-12-29-14-16-32-17-15-29/h2-11H,12-17H2,1H3

Standard InChI Key:  WDWPXUWEUYFBSD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -2.5583   -0.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1958   -0.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5500   -1.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3750    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1333   -0.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1250   -0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7958    0.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1958    0.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0833    1.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3583   -1.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8250    0.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0125    1.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6833    1.9583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5833   -2.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0458    1.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7833    0.8583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5130    1.7838    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6458    1.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7708   -1.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2083   -3.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5958   -0.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6500   -0.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6500   -1.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9833   -0.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9833   -2.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9958   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2375    0.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7958   -3.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8083   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1708   -0.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1708   -0.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3833   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0208    0.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  1  1  0
  6  5  1  0
  7  4  1  0
  8  7  2  0
  9 13  2  0
 10  3  1  0
 11  8  1  0
 12  7  1  0
 13 15  1  0
 14 19  1  0
 15 18  1  0
 16  4  2  0
 17  9  2  0
 18 12  2  0
 19 10  1  0
 20 29  1  0
 21  2  1  0
 22  5  2  0
 23  6  2  0
 24  8  1  0
 25 14  1  0
 26 14  1  0
 27 11  1  0
 28 25  1  0
 29 26  1  0
 30 22  1  0
 31 30  2  0
 32 24  2  0
 33 32  1  0
  3  6  1  0
 31 23  1  0
 15 11  2  0
 27 33  2  0
 20 28  1  0
M  END

Associated Targets(non-human)

Adcy5 Adenylate cyclase type V (89 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cnr1 Cannabinoid CB1 receptor (3458 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 455.58Molecular Weight (Monoisotopic): 455.1667AlogP: 5.40#Rotatable Bonds: 6
Polar Surface Area: 46.83Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.46CX LogP: 5.77CX LogD: 5.72
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.22Np Likeness Score: -1.04

References

1. Yamada K, Rice KC, Flippen-Anderson JL, Eissenstat MA, Ward SJ, Johnson MR, Howlett AC..  (1996)  (Aminoalkyl)indole isothiocyanates as potential electrophilic affinity ligands for the brain cannabinoid receptor.,  39  (10): [PMID:8642555] [10.1021/jm950932r]

Source