The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-Isothiocyanato-naphthalen-1-yl)-[2-methyl-1-(2-morpholin-4-yl-ethyl)-1H-indol-3-yl]-methanone ID: ALA431950
PubChem CID: 10647431
Max Phase: Preclinical
Molecular Formula: C27H25N3O2S
Molecular Weight: 455.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C(=O)c2ccc(N=C=S)c3ccccc23)c2ccccc2n1CCN1CCOCC1
Standard InChI: InChI=1S/C27H25N3O2S/c1-19-26(27(31)22-10-11-24(28-18-33)21-7-3-2-6-20(21)22)23-8-4-5-9-25(23)30(19)13-12-29-14-16-32-17-15-29/h2-11H,12-17H2,1H3
Standard InChI Key: WDWPXUWEUYFBSD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-2.5583 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1958 -0.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5500 -1.1417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3750 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1333 -0.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1250 -0.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7958 0.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1958 0.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0833 1.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3583 -1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8250 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0125 1.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6833 1.9583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5833 -2.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0458 1.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7833 0.8583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5130 1.7838 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.6458 1.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7708 -1.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2083 -3.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5958 -0.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6500 -0.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6500 -1.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9833 -0.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9833 -2.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9958 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2375 0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7958 -3.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8083 -3.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1708 -0.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1708 -0.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3833 -0.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0208 0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 1 1 0
5 1 1 0
6 5 1 0
7 4 1 0
8 7 2 0
9 13 2 0
10 3 1 0
11 8 1 0
12 7 1 0
13 15 1 0
14 19 1 0
15 18 1 0
16 4 2 0
17 9 2 0
18 12 2 0
19 10 1 0
20 29 1 0
21 2 1 0
22 5 2 0
23 6 2 0
24 8 1 0
25 14 1 0
26 14 1 0
27 11 1 0
28 25 1 0
29 26 1 0
30 22 1 0
31 30 2 0
32 24 2 0
33 32 1 0
3 6 1 0
31 23 1 0
15 11 2 0
27 33 2 0
20 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.58Molecular Weight (Monoisotopic): 455.1667AlogP: 5.40#Rotatable Bonds: 6Polar Surface Area: 46.83Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.46CX LogP: 5.77CX LogD: 5.72Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.22Np Likeness Score: -1.04
References 1. Yamada K, Rice KC, Flippen-Anderson JL, Eissenstat MA, Ward SJ, Johnson MR, Howlett AC.. (1996) (Aminoalkyl)indole isothiocyanates as potential electrophilic affinity ligands for the brain cannabinoid receptor., 39 (10): [PMID:8642555 ] [10.1021/jm950932r ]