2,4,6-Trimethyl-benzoic acid 3-[(S)-2-(3-carboxy-propionylamino)-3-phenyl-propionylamino]-2-oxo-propyl ester

ID: ALA432295

PubChem CID: 10050924

Max Phase: Preclinical

Molecular Formula: C26H30N2O7

Molecular Weight: 482.53

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(C(=O)OCC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)CCC(=O)O)c(C)c1

Standard InChI:  InChI=1S/C26H30N2O7/c1-16-11-17(2)24(18(3)12-16)26(34)35-15-20(29)14-27-25(33)21(13-19-7-5-4-6-8-19)28-22(30)9-10-23(31)32/h4-8,11-12,21H,9-10,13-15H2,1-3H3,(H,27,33)(H,28,30)(H,31,32)/t21-/m0/s1

Standard InChI Key:  CHPLXTFIOXIZEC-NRFANRHFSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  1  0  0  0  0  0999 V2000
    5.2542   -8.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1167   -9.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0167   -8.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1750   -5.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6167   -7.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1875   -4.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4417   -3.8917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7292   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8875   -5.4917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6625   -8.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7625   -9.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4125   -3.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7417   -7.0167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2375   -5.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9500   -3.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4542   -5.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8417   -8.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5292   -9.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7292   -5.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1250   -4.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9625   -5.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6625   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1042   -6.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0167   -3.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7000   -4.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4125   -3.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8792   -3.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1500   -7.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3500   -9.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1750   -9.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292   -2.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5667   -2.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5000   -1.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0625   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7500   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  9  1  0
  5  1  1  0
  6  4  1  0
  7  6  1  0
  8  7  1  0
  9 22  1  0
 10  3  2  0
 11  2  1  0
 12 25  1  0
 13  5  1  0
 14 23  1  0
  6 15  1  1
 16  4  2  0
 17  5  2  0
 18 10  1  0
 19  8  2  0
 20 12  2  0
 21 14  2  0
 22 14  1  0
 23 13  1  0
 24  8  1  0
 25 24  1  0
 26 12  1  0
 27 15  1  0
 28  3  1  0
 29  2  1  0
 30 18  1  0
 31 27  1  0
 32 27  2  0
 33 32  1  0
 34 31  2  0
 35 33  2  0
 18 11  2  0
 35 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA432295

   4-oxo-4-[[(2S)-1-oxo-1-[[2-oxo-3-(2,4,6-trimethylbenzoyl)oxypropyl]amino]-3-phenylpropan-2-yl]amino]butanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 482.53

Molecular Weight (Monoisotopic): 482.2053

AlogP: 2.05

#Rotatable Bonds: 12

Polar Surface Area: 138.87

Molecular Species: ACID

HBA: 6

HBD: 3

#RO5 Violations: ┄

HBA (Lipinski): 9

HBD (Lipinski): 3

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 4.20

CX Basic pKa: ┄

CX LogP: 3.16

CX LogD: 0.13

Aromatic Rings: 2

Heavy Atoms: 35

QED Weighted: 0.39

Np Likeness Score: -0.21

References

1. Wagner BM, Smith RA, Coles PJ, Copp LJ, Ernest MJ, Krantz A..  (1994)  In vivo inhibition of cathepsin B by peptidyl (acyloxy)methyl ketones.,  37  (12): [PMID:8021922] [10.1021/jm00038a012]

Source

Source(1):

• Scientific Literature