The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[2-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-ethyl]-2-(3-dimethylamino-phenyl)-3H-quinazolin-4-one ID: ALA433715
PubChem CID: 44369228
Max Phase: Preclinical
Molecular Formula: C29H32N4O3
Molecular Weight: 484.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(CCn1c(-c3cccc(N(C)C)c3)nc3ccccc3c1=O)CC2
Standard InChI: InChI=1S/C29H32N4O3/c1-31(2)23-9-7-8-21(16-23)28-30-25-11-6-5-10-24(25)29(34)33(28)15-14-32-13-12-20-17-26(35-3)27(36-4)18-22(20)19-32/h5-11,16-18H,12-15,19H2,1-4H3
Standard InChI Key: KJWQAMYUAJXZCQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-0.4208 -4.0042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4208 -4.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1375 -3.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 -5.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3000 -5.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1417 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1417 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 -3.5792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8542 -3.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -6.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5667 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5625 -2.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0042 -6.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4292 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1458 -2.7750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0000 -7.3125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0042 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4250 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 -2.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5625 -3.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -3.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 -2.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0125 -4.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5625 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 -6.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7167 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2792 -7.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7125 -7.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -3.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -2.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2750 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2750 -4.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 3 1 0
6 5 1 0
7 2 1 0
8 18 1 0
9 1 1 0
10 22 1 0
11 21 1 0
12 8 1 0
13 7 2 0
14 12 2 0
15 16 2 0
16 10 1 0
17 13 1 0
18 11 1 0
19 3 2 0
20 17 1 0
21 9 1 0
22 23 1 0
23 11 1 0
24 5 2 0
25 14 1 0
26 15 1 0
27 7 1 0
28 6 2 0
29 30 1 0
30 27 2 0
31 20 1 0
32 20 1 0
33 25 1 0
34 26 1 0
35 24 1 0
36 35 2 0
6 4 1 0
28 36 1 0
17 29 2 0
10 8 2 0
14 15 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.60Molecular Weight (Monoisotopic): 484.2474AlogP: 4.21#Rotatable Bonds: 7Polar Surface Area: 59.83Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.87CX LogP: 4.43CX LogD: 4.31Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -1.05
References 1. Wang S, Ryder H, Pretswell I, Depledge P, Milton J, Hancox TC, Dale I, Dangerfield W, Charlton P, Faint R, Dodd R, Hassan S.. (2002) Studies on quinazolinones as dual inhibitors of Pgp and MRP1 in multidrug resistance., 12 (4): [PMID:11844674 ] [10.1016/s0960-894x(01)00804-6 ]