1,1-dimethyl-4-phenyl-2-propylcarboxamidopentanoic anhydride

ID: ALA436591

PubChem CID: 44354968

Max Phase: Preclinical

Molecular Formula: C34H48N2O5

Molecular Weight: 564.77

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCC(=O)NC(CCc1ccccc1)C(C)(C)C(=O)OC(=O)C(C)(C)C(CCc1ccccc1)NC(=O)CCC

Standard InChI:  InChI=1S/C34H48N2O5/c1-7-15-29(37)35-27(23-21-25-17-11-9-12-18-25)33(3,4)31(39)41-32(40)34(5,6)28(36-30(38)16-8-2)24-22-26-19-13-10-14-20-26/h9-14,17-20,27-28H,7-8,15-16,21-24H2,1-6H3,(H,35,37)(H,36,38)

Standard InChI Key:  DGAACZPYHKOXDE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 42  0  0  0  0  0  0  0  0999 V2000
    1.6792   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1125   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9667   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8250   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3917   -2.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2542   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5417   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4625   -2.6417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2542   -2.6417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1750   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9667   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1125   -1.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6792   -1.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1750   -1.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5417   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2542   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9667   -1.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3750   -3.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2375   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4042   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9667   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2542   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9667   -0.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2625   -0.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6792   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8875   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9792    0.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5500    0.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6875    0.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2625    0.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6083   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4000   -2.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3208   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1125   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5500    1.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6917    1.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2542    1.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9792    1.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9792    1.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667    1.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  1  1  0
  4  2  1  0
  5  1  1  0
  6  3  1  0
  7  4  1  0
  8  6  1  0
  9  7  1  0
 10  8  1  0
 11  9  1  0
 12  2  2  0
 13  1  2  0
 14 10  2  0
  7 15  1  0
  6 16  1  0
 17 11  2  0
 18  3  1  0
 19  3  1  0
 20  4  1  0
 21  4  1  0
 22 16  1  0
 23 15  1  0
 24 22  1  0
 25 23  1  0
 26 11  1  0
 27 10  1  0
 28 25  2  0
 29 25  1  0
 30 24  2  0
 31 24  1  0
 32 27  1  0
 33 26  1  0
 34 32  1  0
 35 33  1  0
 36 29  2  0
 37 30  1  0
 38 31  2  0
 39 28  1  0
 40 38  1  0
 41 36  1  0
 37 40  2  0
 39 41  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA436591

   1,1-Dimethyl-4-phenyl-2-propylcarboxamidopentanoic anhydride

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 564.77

Molecular Weight (Monoisotopic): 564.3563

AlogP: 5.94

#Rotatable Bonds: 16

Polar Surface Area: 101.57

Molecular Species: NEUTRAL

HBA: 5

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 7.47

CX LogD: 7.47

Aromatic Rings: 2

Heavy Atoms: 41

QED Weighted: 0.19

Np Likeness Score: -0.03

References

1. Iijima K, Katada J, Hayashi Y..  (1999)  Symmetrical anhydride-type serine protease inhibitors: structure-activity relationship studies of human chymase inhibitors.,  9  (3): [PMID:10091694] [10.1016/s0960-894x(99)00012-8]

2. Iijima K, Katada J, Hayashi Y..  (1999)  Symmetrical anhydride-type serine protease inhibitors: structure-activity relationship studies of human chymase inhibitors.,  9  (3): [PMID:10091694] [10.1016/s0960-894x(99)00012-8]

Source

Source(1):

• Scientific Literature