The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-{3-[6-(1-methanesulfonyl-1-methyl-ethyl)-quinolin-8-yl]-phenyl}-1-oxy-pyridin-2-yl)-propan-2-ol ID: ALA436847
PubChem CID: 10005210
Max Phase: Preclinical
Molecular Formula: C27H28N2O4S
Molecular Weight: 476.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(O)c1ccc(-c2cccc(-c3cc(C(C)(C)S(C)(=O)=O)cc4cccnc34)c2)c[n+]1[O-]
Standard InChI: InChI=1S/C27H28N2O4S/c1-26(2,30)24-12-11-21(17-29(24)31)18-8-6-9-19(14-18)23-16-22(27(3,4)34(5,32)33)15-20-10-7-13-28-25(20)23/h6-17,30H,1-5H3
Standard InChI Key: JFRDONMCKIEZHW-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
2.6944 1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6932 0.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4081 0.4598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4063 2.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1216 1.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1224 0.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8377 0.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5527 0.8806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5480 1.7106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8321 2.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2599 2.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9708 2.5458 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.6776 1.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8424 2.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6833 2.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5534 3.2574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3879 1.8340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8385 -0.3558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1232 -0.7692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1246 -1.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8404 -2.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5564 -1.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5515 -0.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2694 -1.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2727 -2.8178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9886 -3.2262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9779 -1.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6944 -1.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7031 -2.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9933 -4.0512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4240 -3.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1333 -3.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8333 -2.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0213 -3.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 8 2 0
12 17 2 0
5 4 1 0
8 9 1 0
18 19 2 0
4 1 2 0
19 20 1 0
9 10 2 0
20 21 2 0
10 5 1 0
21 22 1 0
22 23 2 0
23 18 1 0
7 18 1 0
9 11 1 0
2 3 2 0
24 25 2 0
11 12 1 0
25 26 1 0
26 29 2 0
5 6 2 0
28 27 2 0
27 24 1 0
22 24 1 0
28 29 1 0
11 13 1 0
3 6 1 0
11 14 1 0
26 30 1 0
6 7 1 0
29 31 1 0
12 15 1 0
31 32 1 0
1 2 1 0
31 33 1 0
12 16 2 0
31 34 1 0
M CHG 2 26 1 30 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.60Molecular Weight (Monoisotopic): 476.1770AlogP: 4.71#Rotatable Bonds: 5Polar Surface Area: 94.20Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.88CX Basic pKa: 3.89CX LogP: 2.92CX LogD: 2.92Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -0.31
References 1. Gallant M, Chauret N, Claveau D, Day S, Deschênes D, Dubé D, Huang Z, Lacombe P, Laliberté F, Lévesque JF, Liu S, Macdonald D, Mancini J, Masson P, Mastracchio A, Nicholson D, Nicoll-Griffith DA, Perrier H, Salem M, Styhler A, Young RN, Girard Y.. (2008) Design, synthesis, and biological evaluation of 8-biarylquinolines: a novel class of PDE4 inhibitors., 18 (4): [PMID:18207397 ] [10.1016/j.bmcl.2008.01.004 ]