The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-ethoxy-3-(1-((2-(2-isopropoxyphenyl)-5-methyloxazol-4-yl)methyl)-1H-indol-5-yl)propanoic acid ID: ALA438088
PubChem CID: 10027350
Max Phase: Preclinical
Molecular Formula: C27H30N2O5
Molecular Weight: 462.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(Cc1ccc2c(ccn2Cc2nc(-c3ccccc3OC(C)C)oc2C)c1)C(=O)O
Standard InChI: InChI=1S/C27H30N2O5/c1-5-32-25(27(30)31)15-19-10-11-23-20(14-19)12-13-29(23)16-22-18(4)34-26(28-22)21-8-6-7-9-24(21)33-17(2)3/h6-14,17,25H,5,15-16H2,1-4H3,(H,30,31)
Standard InChI Key: JLVNHOJWHCMXNK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-1.8225 -24.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8236 -25.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1094 -25.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1110 -24.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3962 -24.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3961 -25.3357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3939 -25.5924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8822 -24.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3938 -24.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6489 -26.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4558 -26.5485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7898 -27.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6103 -27.2210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7818 -26.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0673 -26.0016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3758 -28.0209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5116 -26.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2068 -26.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9359 -26.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9675 -25.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2642 -24.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5380 -25.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5372 -24.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5375 -23.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2521 -22.8590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8232 -22.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1053 -23.2698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8202 -22.0325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9664 -23.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6810 -22.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8375 -24.7737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8649 -23.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1645 -23.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5926 -23.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 16 1 0
6 7 1 0
14 17 1 0
7 8 1 0
17 18 2 0
8 9 2 0
18 19 1 0
9 5 1 0
19 20 2 0
4 1 1 0
20 21 1 0
7 10 1 0
21 22 2 0
22 17 1 0
5 6 1 0
1 23 1 0
10 11 1 0
23 24 1 0
11 12 2 0
24 25 1 0
24 26 1 0
2 3 1 0
3 6 2 0
26 27 1 0
26 28 2 0
1 2 2 0
25 29 1 0
12 13 1 0
29 30 1 0
13 14 1 0
22 31 1 0
14 15 2 0
31 32 1 0
15 11 1 0
32 33 1 0
5 4 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.55Molecular Weight (Monoisotopic): 462.2155AlogP: 5.47#Rotatable Bonds: 10Polar Surface Area: 86.72Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.00CX Basic pKa: 0.32CX LogP: 5.09CX LogD: 1.94Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -0.98
References 1. Kuhn B, Hilpert H, Benz J, Binggeli A, Grether U, Humm R, Märki HP, Meyer M, Mohr P.. (2006) Structure-based design of indole propionic acids as novel PPARalpha/gamma co-agonists., 16 (15): [PMID:16737814 ] [10.1016/j.bmcl.2006.05.007 ]