The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4-dimethyl-tetrahydrofuran-3-yl 4-(hydroxycarbamoyl)-4-((4-o-tolylpiperidin-1-ylsulfonyl)methyl)piperidine-1-carboxylate ID: ALA439405
PubChem CID: 11678245
Max Phase: Preclinical
Molecular Formula: C26H39N3O7S
Molecular Weight: 537.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1C1CCN(S(=O)(=O)CC2(C(=O)NO)CCN(C(=O)OC3COCC3(C)C)CC2)CC1
Standard InChI: InChI=1S/C26H39N3O7S/c1-19-6-4-5-7-21(19)20-8-12-29(13-9-20)37(33,34)18-26(23(30)27-32)10-14-28(15-11-26)24(31)36-22-16-35-17-25(22,2)3/h4-7,20,22,32H,8-18H2,1-3H3,(H,27,30)
Standard InChI Key: VVHOXHYIVMZQIO-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
1.8947 0.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3175 -0.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1379 -0.2047 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.2922 1.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9726 -0.2758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5753 0.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.1528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2495 0.4646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6746 -0.2463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4958 -0.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4707 1.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6432 1.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9603 -0.1885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1521 -1.0296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1217 0.6202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1170 1.2281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8659 1.9184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2645 2.6408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3843 -0.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2032 -0.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6042 -0.1616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1801 0.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3551 0.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4271 -0.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8503 -0.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6745 -0.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0764 -0.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6480 0.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8253 0.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3995 1.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7989 -0.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1299 -0.1322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9662 -0.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1338 -1.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4076 0.2695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3542 -1.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3101 -1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 1 1 0
13 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
1 11 1 0
11 12 1 0
24 25 2 0
6 7 2 0
25 26 1 0
3 13 1 0
26 27 2 0
2 3 1 0
27 28 1 0
3 14 2 0
28 29 2 0
29 24 1 0
21 24 1 0
6 8 1 0
29 30 1 0
3 15 2 0
31 5 1 0
8 9 1 0
4 16 2 0
4 17 1 0
1 2 1 0
17 18 1 0
13 19 1 0
5 6 1 0
1 4 1 0
32 33 1 0
33 34 1 0
34 31 1 0
31 35 1 0
35 32 1 0
8 12 1 0
34 36 1 0
9 10 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.68Molecular Weight (Monoisotopic): 537.2509AlogP: 2.65#Rotatable Bonds: 6Polar Surface Area: 125.48Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.82CX Basic pKa: ┄CX LogP: 1.81CX LogD: 1.80Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -0.38
References 1. Burns DM, He C, Li Y, Scherle P, Liu X, Marando CA, Covington MB, Yang G, Pan M, Turner S, Fridman JS, Hollis G, Vaddi K, Yeleswaram S, Newton R, Friedman S, Metcalf B, Yao W.. (2008) Conversion of an MMP-potent scaffold to an MMP-selective HER-2 sheddase inhibitor via scaffold hybridization and subtle P1' permutations., 18 (2): [PMID:18068976 ] [10.1016/j.bmcl.2007.11.086 ]