N-{(S)-1-[3-(2-Bromo-ethoxy)-4-chloro-1-oxo-isochroman-7-ylcarbamoyl]-2-phenyl-ethyl}-nicotinamide

ID: ALA440537

PubChem CID: 44367845

Max Phase: Preclinical

Molecular Formula: C26H23BrClN3O5

Molecular Weight: 572.84

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(N[C@@H](Cc1ccccc1)C(=O)Nc1ccc2c(c1)C(=O)OC(OCCBr)C2Cl)c1cccnc1

Standard InChI:  InChI=1S/C26H23BrClN3O5/c27-10-12-35-26-22(28)19-9-8-18(14-20(19)25(34)36-26)30-24(33)21(13-16-5-2-1-3-6-16)31-23(32)17-7-4-11-29-15-17/h1-9,11,14-15,21-22,26H,10,12-13H2,(H,30,33)(H,31,32)/t21-,22?,26?/m0/s1

Standard InChI Key:  VTORLFVZJQHBDR-OKFDZGCWSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  1  0  0  0  0  0999 V2000
    6.8417   -1.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3625   -2.2542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3167   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3167   -2.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3625   -2.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4125   -2.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2750   -1.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8417   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7000   -2.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042   -1.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6875   -3.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7625   -1.9625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8000   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8000   -1.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8375   -1.3542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2792   -2.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8125   -2.9875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -1.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2417   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5667   -4.0292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8375   -3.7625    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.2792   -2.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8792   -3.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2917   -3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3917   -4.6625    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    3.3667   -3.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2417   -4.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3917   -4.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8750   -3.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -2.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -4.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6750   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6750   -2.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  3  1  0
  5  2  1  0
  6  9  1  0
  7 12  1  0
  8  4  1  0
  9 10  1  0
 10  7  1  0
 11  6  1  0
 12 16  1  0
 13  4  2  0
 14  3  2  0
 15  1  2  0
 16 14  1  0
 17  6  2  0
 18  7  2  0
 10 19  1  1
 20 24  2  0
 21  8  1  0
 22 16  2  0
 23  5  1  0
 24 11  1  0
 25 19  1  0
 26 29  1  0
 27 11  2  0
 28 33  2  0
 29 30  1  0
 30 23  1  0
 31 25  2  0
 32 25  1  0
 33 27  1  0
 34 32  2  0
 35 31  1  0
 36 34  1  0
  8  5  1  0
 22 13  1  0
 35 36  2  0
 28 20  1  0
M  END

Associated Targets(Human)

ELANE Tclin Leukocyte elastase (8173 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CTRC Tchem Chymotrypsin C (381 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

CELA2A Elastase 2A (403 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 572.84Molecular Weight (Monoisotopic): 571.0510AlogP: 4.25#Rotatable Bonds: 9
Polar Surface Area: 106.62Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.87CX Basic pKa: 3.62CX LogP: 4.38CX LogD: 4.38
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -0.30

References

1. Kerrigan JE, Oleksyszyn J, Kam CM, Selzler J, Powers JC..  (1995)  Mechanism-based isocoumarin inhibitors for human leukocyte elastase. Effect of the 7-amino substituent and 3-alkoxy group in 3-alkoxy-7-amino-4-chloroisocoumarins on inhibitory potency.,  38  (3): [PMID:7853347] [10.1021/jm00003a017]

Source