The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Chloro-N-[4-(5,6,7,8-tetrahydro-thieno[3,2-b]azepine-4-carbonyl)-phenyl]-benzamide ID: ALA441498
PubChem CID: 11418441
Max Phase: Preclinical
Molecular Formula: C22H19ClN2O2S
Molecular Weight: 410.93
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(C(=O)N2CCCCc3sccc32)cc1)c1ccccc1Cl
Standard InChI: InChI=1S/C22H19ClN2O2S/c23-18-6-2-1-5-17(18)21(26)24-16-10-8-15(9-11-16)22(27)25-13-4-3-7-20-19(25)12-14-28-20/h1-2,5-6,8-12,14H,3-4,7,13H2,(H,24,26)
Standard InChI Key: RCIUOILUJSOGMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
3.0500 0.1458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4042 0.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8667 -0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1042 -3.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7125 -4.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4042 1.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2875 -2.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6167 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6167 1.7458 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4750 -1.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1375 1.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5292 -5.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0792 -0.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3167 -3.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2875 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2542 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6792 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 0.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -5.3042 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.8917 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8625 -1.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0500 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1375 -5.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2042 1.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1042 -4.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9250 -5.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 7 1 0
5 4 1 0
6 2 2 0
7 17 1 0
8 2 1 0
9 6 1 0
10 3 1 0
11 8 2 0
12 5 2 0
13 3 2 0
14 4 2 0
15 10 2 0
16 10 1 0
17 21 1 0
18 1 1 0
19 12 1 0
20 15 1 0
21 16 2 0
22 5 1 0
23 6 1 0
24 12 1 0
25 18 1 0
26 22 2 0
27 25 1 0
28 26 1 0
27 23 1 0
9 11 1 0
20 17 2 0
24 28 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.93Molecular Weight (Monoisotopic): 410.0856AlogP: 5.64#Rotatable Bonds: 3Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.47CX LogD: 5.47Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.61Np Likeness Score: -2.13
References 1. Itzhak Y, Kalir A, Weissman BA, Cohen S.. (1981) New analgesic drugs derived from phencyclidine., 24 (5): [PMID:7241506 ] [10.1021/jm00137a004 ]