The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Cyano-4-[(spiro[2.5]oct-6-ylmethyl)-amino]-pyrimidine-5-carboxylic acid [5-(1-methyl-piperidin-4-yloxy)-biphenyl-2-yl]-amide ID: ALA443161
PubChem CID: 44587862
Max Phase: Preclinical
Molecular Formula: C33H38N6O2
Molecular Weight: 550.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCC(Oc2ccc(NC(=O)c3cnc(C#N)nc3NCC3CCC4(CC3)CC4)c(-c3ccccc3)c2)CC1
Standard InChI: InChI=1S/C33H38N6O2/c1-39-17-11-25(12-18-39)41-26-7-8-29(27(19-26)24-5-3-2-4-6-24)37-32(40)28-22-35-30(20-34)38-31(28)36-21-23-9-13-33(14-10-23)15-16-33/h2-8,19,22-23,25H,9-18,21H2,1H3,(H,37,40)(H,35,36,38)
Standard InChI Key: PTUYLYPDSJMPGU-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
18.4462 -18.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0295 -18.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8549 -18.2496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8846 -17.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5996 -17.4367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3098 -17.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0227 -17.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3143 -18.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5952 -18.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8835 -16.2001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4576 -14.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1727 -14.9652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8865 -14.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6017 -14.9629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8853 -13.7265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5985 -15.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3128 -16.1999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0276 -15.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0236 -14.9569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3088 -14.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7433 -16.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4600 -16.6087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4584 -13.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7441 -13.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0293 -13.7338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0332 -14.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7481 -14.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7535 -15.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0432 -16.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0482 -17.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7659 -17.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4800 -17.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4714 -16.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3136 -13.3234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3112 -12.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0255 -12.0892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0251 -11.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3112 -10.8536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5961 -11.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5949 -12.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3119 -10.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20 14 1 0
16 10 1 0
4 5 1 0
18 21 1 0
4 10 1 0
21 22 3 0
5 6 1 0
11 23 2 0
2 1 1 0
23 24 1 0
11 12 1 0
24 25 2 0
3 2 1 0
25 26 1 0
12 13 1 0
26 27 2 0
27 11 1 0
1 3 1 0
27 28 1 0
13 14 1 0
28 29 2 0
29 30 1 0
13 15 2 0
30 31 2 0
5 9 1 0
31 32 1 0
14 16 2 0
32 33 2 0
33 28 1 0
6 7 1 0
25 34 1 0
16 17 1 0
34 35 1 0
35 36 1 0
7 2 1 0
17 18 2 0
2 8 1 0
18 19 1 0
8 9 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
19 20 2 0
38 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.71Molecular Weight (Monoisotopic): 550.3056AlogP: 6.12#Rotatable Bonds: 8Polar Surface Area: 103.17Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.89CX Basic pKa: 8.57CX LogP: 6.20CX LogD: 5.00Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.35Np Likeness Score: -0.63
References 1. Irie O, Yokokawa F, Ehara T, Iwasaki A, Iwaki Y, Hitomi Y, Konishi K, Kishida M, Toyao A, Masuya K, Gunji H, Sakaki J, Iwasaki G, Hirao H, Kanazawa T, Tanabe K, Kosaka T, Hart TW, Hallett A.. (2008) 4-Amino-2-cyanopyrimidines: novel scaffold for nonpeptidic cathepsin S inhibitors., 18 (16): [PMID:18662880 ] [10.1016/j.bmcl.2008.07.011 ]