The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6,7-Dimethoxy-2-((4'-(3-((4-benzyloxy-1,2,5-oxadiazol-3-yl)oxy)-propoxy)biphen-4-yl)methyl)-1,2,3,4-tetrahydroisoquinoline ID: ALA4434729
PubChem CID: 155510784
Max Phase: Preclinical
Molecular Formula: C36H37N3O6
Molecular Weight: 607.71
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(Cc1ccc(-c3ccc(OCCCOc4nonc4OCc4ccccc4)cc3)cc1)CC2
Standard InChI: InChI=1S/C36H37N3O6/c1-40-33-21-30-17-18-39(24-31(30)22-34(33)41-2)23-26-9-11-28(12-10-26)29-13-15-32(16-14-29)42-19-6-20-43-35-36(38-45-37-35)44-25-27-7-4-3-5-8-27/h3-5,7-16,21-22H,6,17-20,23-25H2,1-2H3
Standard InChI Key: OIMLVEXTXUUPDK-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
2.3222 -15.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3211 -16.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0291 -16.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0273 -15.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7359 -15.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7393 -16.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4517 -16.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1653 -16.2804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1619 -15.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4449 -15.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8741 -16.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5807 -16.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2856 -16.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9917 -16.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9899 -15.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2761 -15.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5729 -15.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6925 -15.0465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4021 -15.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1077 -15.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1048 -14.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3905 -13.8196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6879 -14.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8103 -13.8127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5202 -14.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2257 -13.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9356 -14.2099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6411 -13.7975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3510 -14.2023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4367 -15.0142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2370 -15.1798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6418 -14.4698 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0916 -13.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6130 -16.6923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9057 -16.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6144 -15.0563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9068 -15.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2562 -13.0652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0317 -12.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1963 -12.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9731 -11.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1379 -10.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5266 -10.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7479 -10.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5869 -11.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 29 1 0
2 34 1 0
34 35 1 0
1 36 1 0
36 37 1 0
33 38 1 0
38 39 1 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.71Molecular Weight (Monoisotopic): 607.2682AlogP: 6.74#Rotatable Bonds: 14Polar Surface Area: 88.31Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.70CX LogP: 6.90CX LogD: 6.43Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.13Np Likeness Score: -0.78
References 1. Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A.. (2016) Structure-Activity Relationship Studies on Tetrahydroisoquinoline Derivatives: [4'-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol] (MC70) Conjugated through Flexible Alkyl Chains with Furazan Moieties Gives Rise to Potent and Selective Ligands of P-glycoprotein., 59 (14): [PMID:27336199 ] [10.1021/acs.jmedchem.6b00252 ]