Ethyl 4-(8-Chloro-2-(4-methylpiperazin-1-yl)-4-oxoquinazolin-3(4H)-yl)-benzoate

ID: ALA4435283

PubChem CID: 155510955

Max Phase: Preclinical

Molecular Formula: C22H23ClN4O3

Molecular Weight: 426.90

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(-n2c(N3CCN(C)CC3)nc3c(Cl)cccc3c2=O)cc1

Standard InChI:  InChI=1S/C22H23ClN4O3/c1-3-30-21(29)15-7-9-16(10-8-15)27-20(28)17-5-4-6-18(23)19(17)24-22(27)26-13-11-25(2)12-14-26/h4-10H,3,11-14H2,1-2H3

Standard InChI Key:  LWQKEJUMJOMCEZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   11.6828   -3.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6816   -4.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3897   -4.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3879   -2.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0965   -3.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0999   -4.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8123   -4.5761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5258   -4.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5224   -3.3377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8055   -2.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3882   -5.3928    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.8010   -2.1086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2278   -2.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9371   -3.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6430   -2.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6410   -2.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9270   -1.7010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2240   -2.1134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2346   -4.5696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2338   -5.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9385   -5.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6475   -5.3865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6473   -4.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9380   -4.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3548   -5.7958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3494   -1.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0590   -2.0983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3458   -0.8757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7648   -1.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4744   -2.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  3 11  1  0
 10 12  2  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  9 13  1  0
  8 19  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 26 27  1  0
 26 28  2  0
 16 26  1  0
 27 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4435283

    ---

Associated Targets(Human)

TRPV4 Tchem Transient receptor potential cation channel subfamily V member 4 (774 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.90Molecular Weight (Monoisotopic): 426.1459AlogP: 2.97#Rotatable Bonds: 4
Polar Surface Area: 67.67Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.27CX LogP: 3.73CX LogD: 3.49
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: -1.37

References

1. Atobe M, Nagami T, Muramatsu S, Ohno T, Kitagawa M, Suzuki H, Ishiguro M, Watanabe A, Kawanishi M..  (2019)  Discovery of Novel Transient Receptor Potential Vanilloid 4 (TRPV4) Agonists as Regulators of Chondrogenic Differentiation: Identification of Quinazolin-4(3 H)-ones and in Vivo Studies on a Surgically Induced Rat Model of Osteoarthritis.,  62  (3): [PMID:30629441] [10.1021/acs.jmedchem.8b01615]

Source