The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1R,4S,6R-1,4-endoperoxy-bisabola-2,10-diene ID: ALA4435343
PubChem CID: 70697737
Max Phase: Preclinical
Molecular Formula: C15H24O2
Molecular Weight: 236.35
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCC[C@H](C)[C@H]1C[C@@H]2OO[C@H]1C=C2C
Standard InChI: InChI=1S/C15H24O2/c1-10(2)6-5-7-11(3)13-9-14-12(4)8-15(13)17-16-14/h6,8,11,13-15H,5,7,9H2,1-4H3/t11-,13+,14-,15-/m0/s1
Standard InChI Key: LJPSCRDRIZSODI-ATGSNQNLSA-N
Molfile:
RDKit 2D
20 21 0 0 0 0 0 0 0 0999 V2000
14.3958 -11.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3958 -12.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1011 -13.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8063 -12.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8063 -11.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1011 -11.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6869 -11.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6845 -10.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9804 -11.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9828 -12.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6917 -13.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6941 -13.8984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4030 -14.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9875 -14.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5134 -13.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8291 -11.9318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2501 -12.4312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3916 -13.4878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.7990 -11.0362 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.3916 -11.0362 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
1 7 1 0
7 8 1 6
7 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
12 14 1 0
4 15 1 0
2 16 1 0
5 17 1 0
17 16 1 0
2 18 1 6
5 19 1 6
1 20 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 236.35Molecular Weight (Monoisotopic): 236.1776AlogP: 4.03#Rotatable Bonds: 4Polar Surface Area: 18.46Molecular Species: ┄HBA: 2HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.19CX LogD: 4.19Aromatic Rings: ┄Heavy Atoms: 17QED Weighted: 0.54Np Likeness Score: 2.73