The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Mollolide A ID: ALA4435493
PubChem CID: 155511354
Max Phase: Preclinical
Molecular Formula: C20H32O8
Molecular Weight: 400.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)[C@@H]1C[C@@H](O)[C@H]2[C@@H](O)[C@@]1(C[C@H]1OC(=O)C(C)(C)[C@]1(O)CCO)C[C@@]2(C)O
Standard InChI: InChI=1S/C20H32O8/c1-10(22)11-7-12(23)14-15(24)19(11,9-18(14,4)26)8-13-20(27,5-6-21)17(2,3)16(25)28-13/h11-15,21,23-24,26-27H,5-9H2,1-4H3/t11-,12+,13+,14-,15+,18+,19-,20-/m0/s1
Standard InChI Key: LDBZVNJHWKNRTA-OQKDTPBPSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
42.6316 -12.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2986 -12.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9638 -12.4938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.7018 -11.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8787 -11.7151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.8758 -10.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.4680 -11.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.2918 -11.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3892 -12.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2174 -12.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8012 -11.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1403 -11.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.9225 -12.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7272 -12.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0136 -12.2144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7588 -13.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6714 -12.9066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.7167 -13.1233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.4208 -11.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3039 -13.8028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1612 -11.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4463 -11.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7344 -11.3034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8706 -10.8892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8461 -12.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6242 -13.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2218 -10.8127 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
43.6988 -10.8806 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
46.6209 -13.2082 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
44.9560 -13.2215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.9711 -13.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 1 0
4 5 1 0
5 1 1 0
7 6 1 0
7 8 1 6
9 10 1 0
10 7 1 0
7 11 1 0
11 12 1 0
12 9 1 0
10 13 1 0
13 14 1 0
14 15 1 0
12 15 1 0
15 16 1 0
9 17 1 1
13 18 1 1
12 19 1 6
4 19 1 0
2 20 2 0
5 21 1 0
21 22 1 0
22 23 1 0
5 24 1 1
1 25 1 0
1 26 1 0
15 27 1 6
4 28 1 6
10 29 1 6
16 30 2 0
16 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.47Molecular Weight (Monoisotopic): 400.2097AlogP: -0.47#Rotatable Bonds: 5Polar Surface Area: 144.52Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.08CX Basic pKa: ┄CX LogP: -1.50CX LogD: -1.50Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.39Np Likeness Score: 1.99
References 1. Li CH, Zhang JY, Zhang XY, Li SH, Gao JM.. (2019) An overview of grayanane diterpenoids and their biological activities from the Ericaceae family in the last seven years., 166 [PMID:30739823 ] [10.1016/j.ejmech.2019.01.079 ]