Mollolide A

ID: ALA4435493

PubChem CID: 155511354

Max Phase: Preclinical

Molecular Formula: C20H32O8

Molecular Weight: 400.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)[C@@H]1C[C@@H](O)[C@H]2[C@@H](O)[C@@]1(C[C@H]1OC(=O)C(C)(C)[C@]1(O)CCO)C[C@@]2(C)O

Standard InChI:  InChI=1S/C20H32O8/c1-10(22)11-7-12(23)14-15(24)19(11,9-18(14,4)26)8-13-20(27,5-6-21)17(2,3)16(25)28-13/h11-15,21,23-24,26-27H,5-9H2,1-4H3/t11-,12+,13+,14-,15+,18+,19-,20-/m0/s1

Standard InChI Key:  LDBZVNJHWKNRTA-OQKDTPBPSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   42.6316  -12.5023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2986  -12.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9638  -12.4938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.7018  -11.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8787  -11.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.8758  -10.9954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.4680  -11.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.2918  -11.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3892  -12.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2174  -12.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8012  -11.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1403  -11.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.9225  -12.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.7272  -12.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0136  -12.2144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7588  -13.0384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6714  -12.9066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   47.7167  -13.1233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.4208  -11.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3039  -13.8028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1612  -11.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4463  -11.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7344  -11.3034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8706  -10.8892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.8461  -12.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6242  -13.3229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2218  -10.8127    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   43.6988  -10.8806    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   46.6209  -13.2082    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   44.9560  -13.2215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.9711  -13.8326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  0
  4  5  1  0
  5  1  1  0
  7  6  1  0
  7  8  1  6
  9 10  1  0
 10  7  1  0
  7 11  1  0
 11 12  1  0
 12  9  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 12 15  1  0
 15 16  1  0
  9 17  1  1
 13 18  1  1
 12 19  1  6
  4 19  1  0
  2 20  2  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
  5 24  1  1
  1 25  1  0
  1 26  1  0
 15 27  1  6
  4 28  1  6
 10 29  1  6
 16 30  2  0
 16 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4435493

    ---

Associated Targets(non-human)

Coxsackievirus B3 (1096 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.47Molecular Weight (Monoisotopic): 400.2097AlogP: -0.47#Rotatable Bonds: 5
Polar Surface Area: 144.52Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 13.08CX Basic pKa: CX LogP: -1.50CX LogD: -1.50
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.39Np Likeness Score: 1.99

References

1. Li CH, Zhang JY, Zhang XY, Li SH, Gao JM..  (2019)  An overview of grayanane diterpenoids and their biological activities from the Ericaceae family in the last seven years.,  166  [PMID:30739823] [10.1016/j.ejmech.2019.01.079]

Source