N-(3-imidazol-1-ylpropyl)-2-[4-(trifluoromethyl)phenyl]-3H-imidazo[4,5-b]pyridine-7-sulfonamide

ID: ALA4435779

PubChem CID: 155511142

Max Phase: Preclinical

Molecular Formula: C19H17F3N6O2S

Molecular Weight: 450.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(NCCCn1ccnc1)c1ccnc2[nH]c(-c3ccc(C(F)(F)F)cc3)nc12

Standard InChI:  InChI=1S/C19H17F3N6O2S/c20-19(21,22)14-4-2-13(3-5-14)17-26-16-15(6-8-24-18(16)27-17)31(29,30)25-7-1-10-28-11-9-23-12-28/h2-6,8-9,11-12,25H,1,7,10H2,(H,24,26,27)

Standard InChI Key:  ORZWWVCRDQQIBS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   13.5421  -16.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2501  -15.7697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9543  -16.1764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9543  -16.9958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2527  -17.4024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5421  -17.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7370  -17.2501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2144  -16.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7371  -15.9262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0338  -16.5842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4418  -15.8762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2619  -15.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6697  -16.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2628  -17.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4440  -17.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4892  -16.5856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8968  -15.8776    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.8968  -17.2978    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.3086  -16.5856    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.2501  -14.9503    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.9626  -14.5401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9626  -13.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6706  -13.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3787  -13.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0868  -13.3088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1760  -12.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9735  -12.3274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3850  -13.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8375  -13.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8414  -14.2403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4307  -14.9503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  8  7  1  0
  9  8  2  0
  3  9  1  0
 10  8  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 13 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
  2 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 26 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 25  1  0
 20 30  2  0
 20 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4435779

    ---

Associated Targets(Human)

GSK3A Tclin Glycogen synthase kinase-3 (736 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.45Molecular Weight (Monoisotopic): 450.1086AlogP: 3.21#Rotatable Bonds: 7
Polar Surface Area: 105.56Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.13CX Basic pKa: 6.64CX LogP: 2.11CX LogD: 1.91
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -1.77

References

1. Vanda D, Zajdel P, Soural M..  (2019)  Imidazopyridine-based selective and multifunctional ligands of biological targets associated with psychiatric and neurodegenerative diseases.,  181  [PMID:31404862] [10.1016/j.ejmech.2019.111569]

Source