ethyl 4-(2-(4-(4-(2-amino-2-oxoethyl)-2-fluorophenylamino)thieno[2,3-d]pyridazin-7-yl)phenoxy)butylcarbamate

ID: ALA4435909

PubChem CID: 155511627

Max Phase: Preclinical

Molecular Formula: C27H28FN5O4S

Molecular Weight: 537.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)NCCCCOc1ccccc1-c1nnc(Nc2ccc(CC(N)=O)cc2F)c2ccsc12

Standard InChI:  InChI=1S/C27H28FN5O4S/c1-2-36-27(35)30-12-5-6-13-37-22-8-4-3-7-18(22)24-25-19(11-14-38-25)26(33-32-24)31-21-10-9-17(15-20(21)28)16-23(29)34/h3-4,7-11,14-15H,2,5-6,12-13,16H2,1H3,(H2,29,34)(H,30,35)(H,31,33)

Standard InChI Key:  UTOLBIKRYSTIJH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    6.7521   -7.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9288   -5.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6385   -5.1031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6357   -4.2804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9271   -3.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2208   -5.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2220   -4.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4458   -4.0335    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.9648   -4.6934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4439   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9219   -3.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6293   -2.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6259   -1.8356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9158   -1.4294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2077   -1.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146   -2.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9286   -6.3297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6363   -6.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6319   -7.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3387   -7.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0475   -7.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0451   -6.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3377   -6.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4629   -7.5526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1711   -7.9604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4620   -6.7354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9230   -7.9604    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.3385   -3.0581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0448   -2.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7539   -3.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4602   -2.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1693   -3.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8756   -2.6368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5847   -3.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2910   -2.6318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5877   -3.8601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0001   -3.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7064   -2.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  7  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 11  1  0
  2 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21  1  1  0
  1 24  1  0
 24 25  1  0
 24 26  2  0
 19 27  1  0
 12 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4435909

    ---

Associated Targets(non-human)

Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.62Molecular Weight (Monoisotopic): 537.1846AlogP: 5.17#Rotatable Bonds: 12
Polar Surface Area: 128.46Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.93CX Basic pKa: 0.83CX LogP: 4.11CX LogD: 4.11
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -1.53

References

1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y..  (2019)  Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators.,  29  (14): [PMID:31101471] [10.1016/j.bmcl.2019.05.013]

Source