The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 4-(2-(4-(4-(2-amino-2-oxoethyl)-2-fluorophenylamino)thieno[2,3-d]pyridazin-7-yl)phenoxy)butylcarbamate ID: ALA4435909
PubChem CID: 155511627
Max Phase: Preclinical
Molecular Formula: C27H28FN5O4S
Molecular Weight: 537.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)NCCCCOc1ccccc1-c1nnc(Nc2ccc(CC(N)=O)cc2F)c2ccsc12
Standard InChI: InChI=1S/C27H28FN5O4S/c1-2-36-27(35)30-12-5-6-13-37-22-8-4-3-7-18(22)24-25-19(11-14-38-25)26(33-32-24)31-21-10-9-17(15-20(21)28)16-23(29)34/h3-4,7-11,14-15H,2,5-6,12-13,16H2,1H3,(H2,29,34)(H,30,35)(H,31,33)
Standard InChI Key: UTOLBIKRYSTIJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
6.7521 -7.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9288 -5.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6385 -5.1031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6357 -4.2804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9271 -3.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2208 -5.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2220 -4.2870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4458 -4.0335 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.9648 -4.6934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4439 -5.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9219 -3.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6293 -2.6520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6259 -1.8356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9158 -1.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2077 -1.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2146 -2.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9286 -6.3297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6363 -6.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6319 -7.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3387 -7.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0475 -7.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0451 -6.7327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3377 -6.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4629 -7.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1711 -7.9604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4620 -6.7354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9230 -7.9604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.3385 -3.0581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0448 -2.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7539 -3.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4602 -2.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1693 -3.0479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8756 -2.6368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5847 -3.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2910 -2.6318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5877 -3.8601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0001 -3.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7064 -2.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 7 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 6 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
5 11 1 0
2 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 1 1 0
1 24 1 0
24 25 1 0
24 26 2 0
19 27 1 0
12 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.62Molecular Weight (Monoisotopic): 537.1846AlogP: 5.17#Rotatable Bonds: 12Polar Surface Area: 128.46Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.93CX Basic pKa: 0.83CX LogP: 4.11CX LogD: 4.11Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -1.53
References 1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y.. (2019) Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators., 29 (14): [PMID:31101471 ] [10.1016/j.bmcl.2019.05.013 ]