1-(3-(tert-Butyl)-1-(3-chlorophenyl)-1H-pyrazol-5-yl)-3-(4-(8-(cyclopropylamino)imidazo[1,2-a]pyrazin-5-yl)-3-methylphenyl)urea

ID: ALA4436013

PubChem CID: 142727706

Max Phase: Preclinical

Molecular Formula: C30H31ClN8O

Molecular Weight: 555.09

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(NC(=O)Nc2cc(C(C)(C)C)nn2-c2cccc(Cl)c2)ccc1-c1cnc(NC2CC2)c2nccn12

Standard InChI:  InChI=1S/C30H31ClN8O/c1-18-14-21(10-11-23(18)24-17-33-27(34-20-8-9-20)28-32-12-13-38(24)28)35-29(40)36-26-16-25(30(2,3)4)37-39(26)22-7-5-6-19(31)15-22/h5-7,10-17,20H,8-9H2,1-4H3,(H,33,34)(H2,35,36,40)

Standard InChI Key:  LZZJNTYYQVVLLF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
    3.1037  -25.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8090  -26.2368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5184  -25.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5184  -25.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1014  -25.0071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8090  -24.5942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6388  -23.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8219  -23.7056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4898  -24.4564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2278  -24.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9387  -25.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6512  -24.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6541  -23.7868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9384  -23.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2288  -23.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3930  -26.2429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3953  -27.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3665  -23.3793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0777  -23.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7902  -23.3816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0764  -24.6103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4973  -23.7913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5876  -24.6074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3908  -24.7786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8005  -24.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2505  -23.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1707  -25.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3487  -25.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9361  -26.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3402  -26.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1653  -26.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5784  -26.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9874  -27.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8087  -27.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5170  -23.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6181  -24.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0322  -24.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0295  -23.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4395  -24.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1148  -26.0114    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  4 10  1  0
  1 16  1  0
 16 17  1  0
 13 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  2  0
 23 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 33 17  1  0
 34 33  1  0
 17 34  1  0
 15 35  1  0
 25 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
 29 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4436013

    ---

Associated Targets(Human)

MAP3K7 Tchem Mitogen-activated protein kinase kinase kinase 7 (1167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.09Molecular Weight (Monoisotopic): 554.2309AlogP: 7.06#Rotatable Bonds: 6
Polar Surface Area: 101.17Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.32CX Basic pKa: 3.60CX LogP: 6.01CX LogD: 6.01
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.98

References

1. Kang SJ, Lee JW, Chung SH, Jang SY, Choi J, Suh KH, Kim YH, Ham YJ, Min KH..  (2019)  Synthesis and anti-tumor activity of imidazopyrazines as TAK1 inhibitors.,  163  [PMID:30576901] [10.1016/j.ejmech.2018.12.025]

Source