(3'R,4'S,5'R)-6''-Chloro-4'-(3-chloro-2-fluorophenyl)-N-(2-(2-(3-(2-(2,6-dioxopiperidin-3-yl)-1-oxoisoindolin-4-yl)propoxy)ethoxy)-ethyl)-2''-oxodispiro[cyclohexane-1,2'-pyrrolidine-3',3''-indoline]-5'-carboxamide

ID: ALA4436533

PubChem CID: 155511728

Max Phase: Preclinical

Molecular Formula: C43H46Cl2FN5O7

Molecular Weight: 834.77

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CCC(N2Cc3c(CCCOCCOCCNC(=O)[C@@H]4NC5(CCCCC5)[C@@]5(C(=O)Nc6cc(Cl)ccc65)[C@H]4c4cccc(Cl)c4F)cccc3C2=O)C(=O)N1

Standard InChI:  InChI=1S/C43H46Cl2FN5O7/c44-26-12-13-30-32(23-26)48-41(56)43(30)35(28-10-5-11-31(45)36(28)46)37(50-42(43)16-2-1-3-17-42)39(54)47-18-20-58-22-21-57-19-6-8-25-7-4-9-27-29(25)24-51(40(27)55)33-14-15-34(52)49-38(33)53/h4-5,7,9-13,23,33,35,37,50H,1-3,6,8,14-22,24H2,(H,47,54)(H,48,56)(H,49,52,53)/t33?,35-,37+,43+/m0/s1

Standard InChI Key:  WKDUIOWFBZEINK-CBAKROEESA-N

Molfile:  

 
     RDKit          2D

 58 65  0  0  0  0  0  0  0  0999 V2000
   13.7579   -3.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9055   -2.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1106   -1.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5388   -2.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1200   -2.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5451   -3.4782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9160   -4.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7204   -4.0746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8463   -3.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5738   -2.8977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2974   -4.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0851   -5.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6601   -6.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4505   -5.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6628   -5.0163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0846   -4.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2956   -3.6456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0271   -6.3855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2928   -7.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5033   -8.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2869   -8.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8655   -8.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6550   -7.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8659   -7.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5047   -7.8200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3326   -6.7893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5686   -6.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0571   -7.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3115   -8.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3104   -8.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0184   -9.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0166   -7.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7253   -8.0775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7301   -8.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5101   -9.1445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9875   -8.4794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6024   -9.3086    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.6932   -8.8859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3539   -5.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9294   -5.1308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5637   -5.5027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2622   -6.9214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0535   -6.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2595   -5.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6748   -6.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8895   -7.2889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6832   -7.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0476   -5.3035    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.0504   -5.1184    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.7196   -5.3391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2951   -4.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0853   -4.9673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6608   -4.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4510   -4.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0265   -4.0152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8167   -4.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3922   -3.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1824   -3.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  8 11  1  0
 16 17  2  0
 14 18  2  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 25 19  1  0
 19 26  1  0
 26 27  1  0
 27 28  1  0
 28 25  1  0
 29 30  2  0
 30 31  1  0
 31 34  2  0
 33 32  2  0
 32 29  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 25 36  1  1
 25 33  1  0
 30 37  1  0
 36 38  2  0
 27 39  1  6
 39 40  1  0
 39 41  2  0
 28 42  1  1
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 46 47  2  0
 47 42  1  0
 43 48  1  0
 44 49  1  0
 40 50  1  0
 50 51  1  0
 51 52  1  0
 52 53  1  0
 53 54  1  0
 54 55  1  0
 55 56  1  0
 56 57  1  0
 57 58  1  0
 58  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4436533

    ---

Associated Targets(Human)

RS4-11 (1012 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CRBN Tclin Cereblon/GSPT1/Cullin-4A/DDB1 (28 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GSPT1 Tbio Eukaryotic peptide chain release factor GTP-binding subunit ERF3A (99 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 834.77Molecular Weight (Monoisotopic): 833.2758AlogP: 5.32#Rotatable Bonds: 13
Polar Surface Area: 155.17Molecular Species: BASEHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 3
CX Acidic pKa: 11.59CX Basic pKa: 9.07CX LogP: 4.93CX LogD: 3.27
Aromatic Rings: 3Heavy Atoms: 58QED Weighted: 0.13Np Likeness Score: -0.05

References

1. Yang J, Li Y, Aguilar A, Liu Z, Yang CY, Wang S..  (2019)  Simple Structural Modifications Converting a Bona fide MDM2 PROTAC Degrader into a Molecular Glue Molecule: A Cautionary Tale in the Design of PROTAC Degraders.,  62  (21): [PMID:31560543] [10.1021/acs.jmedchem.9b00846]

Source