4-amino-1-(biphenyl-2-yl)-5-chloropyrimidin-2(1H)-one

ID: ALA4436811

PubChem CID: 155144946

Max Phase: Preclinical

Molecular Formula: C16H12ClN3O

Molecular Weight: 297.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(=O)n(-c2ccccc2-c2ccccc2)cc1Cl

Standard InChI:  InChI=1S/C16H12ClN3O/c17-13-10-20(16(21)19-15(13)18)14-9-5-4-8-12(14)11-6-2-1-3-7-11/h1-10H,(H2,18,19,21)

Standard InChI Key:  BCBGEFABBHZRRI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   14.1082  -19.6123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1082  -20.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8202  -20.8456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5323  -20.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5323  -19.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8202  -19.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8202  -18.3707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2479  -19.2018    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.3943  -20.8508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8197  -21.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1036  -22.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1033  -22.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8183  -23.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5352  -22.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5319  -22.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2424  -21.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9583  -22.0767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6712  -21.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6694  -20.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9487  -20.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2388  -20.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  5  8  1  0
  2  9  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  3 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 15 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4436811

    ---

Associated Targets(Human)

TET2 Tchem Methylcytosine dioxygenase TET2 (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TET1 Tbio Methylcytosine dioxygenase TET1 (33 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 297.75Molecular Weight (Monoisotopic): 297.0669AlogP: 3.14#Rotatable Bonds: 2
Polar Surface Area: 60.91Molecular Species: HBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.95CX LogD: 2.95
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.79Np Likeness Score: -0.48

References

1. Chua GNL, Wassarman KL, Sun H, Alp JA, Jarczyk EI, Kuzio NJ, Bennett MJ, Malachowsky BG, Kruse M, Kennedy AJ..  (2019)  Cytosine-Based TET Enzyme Inhibitors.,  10  (2): [PMID:30783500] [10.1021/acsmedchemlett.8b00474]

Source