The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
trans-2,3-Bis(benzyloxy)-8-ethyl-13-methyl-8,9,11,13a-tetrahydro-5H-azocino[2,1-a]isoquinolin-10(6H)-one ID: ALA4436900
PubChem CID: 155512238
Max Phase: Preclinical
Molecular Formula: C32H35NO3
Molecular Weight: 481.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H]1CC(=O)C/C=C(/C)[C@H]2c3cc(OCc4ccccc4)c(OCc4ccccc4)cc3CCN12
Standard InChI: InChI=1S/C32H35NO3/c1-3-27-19-28(34)15-14-23(2)32-29-20-31(36-22-25-12-8-5-9-13-25)30(18-26(29)16-17-33(27)32)35-21-24-10-6-4-7-11-24/h4-14,18,20,27,32H,3,15-17,19,21-22H2,1-2H3/b23-14-/t27-,32+/m1/s1
Standard InChI Key: WKPPECSDZYIVIH-ADBCMCJNSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
10.7515 -19.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5613 -19.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7851 -18.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0239 -18.9342 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.0758 -18.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3692 -18.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6533 -18.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9528 -18.6138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2338 -18.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5348 -18.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5348 -19.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8150 -19.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0952 -19.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0952 -18.5779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8153 -18.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6533 -17.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9538 -16.9766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9538 -16.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2549 -15.7425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5564 -16.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8365 -15.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8365 -14.8989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5566 -14.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2766 -14.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3724 -16.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0918 -17.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7906 -16.9773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5104 -17.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5104 -18.2242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2888 -18.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6973 -19.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9707 -20.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7587 -20.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4678 -19.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1150 -20.4491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7922 -17.7951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6051 -17.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 6
3 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
10 15 1 0
7 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
19 24 1 0
16 25 1 0
25 26 2 0
5 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
3 29 1 0
29 30 1 0
30 31 1 0
2 32 2 0
32 33 1 0
33 34 1 0
31 34 1 0
34 35 2 0
30 36 1 6
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.64Molecular Weight (Monoisotopic): 481.2617AlogP: 6.83#Rotatable Bonds: 7Polar Surface Area: 38.77Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.68CX LogP: 6.84CX LogD: 6.38Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: 0.25
References 1. Zheng H, Dong Y, Li L, Sun B, Liu L, Yuan H, Lou H.. (2016) Novel Benzo[a]quinolizidine Analogs Induce Cancer Cell Death through Paraptosis and Apoptosis., 59 (10): [PMID:27077446 ] [10.1021/acs.jmedchem.6b00484 ]