The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Hydroxy-7-(6-(4-(3-butylureido)phenyl)-4-morpholino-1H-pyrazolo[3,4-d]pyrimidin-1-yl)heptanamide ID: ALA4437152
PubChem CID: 155512298
Max Phase: Preclinical
Molecular Formula: C27H38N8O4
Molecular Weight: 538.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNC(=O)Nc1ccc(-c2nc(N3CCOCC3)c3cnn(CCCCCCC(=O)NO)c3n2)cc1
Standard InChI: InChI=1S/C27H38N8O4/c1-2-3-13-28-27(37)30-21-11-9-20(10-12-21)24-31-25(34-15-17-39-18-16-34)22-19-29-35(26(22)32-24)14-7-5-4-6-8-23(36)33-38/h9-12,19,38H,2-8,13-18H2,1H3,(H,33,36)(H2,28,30,37)
Standard InChI Key: JVKKVFVDDHURQO-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
4.3463 -20.4671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8857 -19.2411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8846 -20.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5926 -20.4696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5908 -18.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5884 -18.0151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2951 -17.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2946 -16.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5875 -16.3873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8792 -16.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8780 -17.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2994 -19.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3042 -20.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0848 -20.3042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5616 -19.6394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0765 -18.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5089 -21.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3259 -20.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7499 -21.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5669 -21.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9909 -22.3641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8079 -22.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2008 -21.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0178 -21.6118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7768 -20.9311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1698 -20.2146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1765 -20.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4708 -20.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7632 -20.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7621 -21.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4745 -21.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1791 -21.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0546 -21.6925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3467 -21.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6392 -21.6932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9313 -21.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2238 -21.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5159 -21.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8084 -21.6948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34 1 2 0
2 3 2 0
3 4 1 0
4 13 2 0
12 5 2 0
5 2 1 0
5 6 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 12 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
3 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.65Molecular Weight (Monoisotopic): 538.3016AlogP: 3.71#Rotatable Bonds: 13Polar Surface Area: 146.53Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.91CX Basic pKa: 3.71CX LogP: 3.62CX LogD: 3.60Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: -1.89
References 1. Chen Y, Yuan X, Zhang W, Tang M, Zheng L, Wang F, Yan W, Yang S, Wei Y, He J, Chen L.. (2019) Discovery of Novel Dual Histone Deacetylase and Mammalian Target of Rapamycin Target Inhibitors as a Promising Strategy for Cancer Therapy., 62 (3): [PMID:30629434 ] [10.1021/acs.jmedchem.8b01825 ]