The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(N-[2-(Benzylamino)-2-oxoethyl]-5-(dimethylamino)naphthalene-1-sulfonamido)-N-hydroxyhexanamide ID: ALA4437165
PubChem CID: 155512401
Max Phase: Preclinical
Molecular Formula: C27H34N4O5S
Molecular Weight: 526.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cccc2c(S(=O)(=O)N(CCCCCC(=O)NO)CC(=O)NCc3ccccc3)cccc12
Standard InChI: InChI=1S/C27H34N4O5S/c1-30(2)24-15-9-14-23-22(24)13-10-16-25(23)37(35,36)31(18-8-4-7-17-26(32)29-34)20-27(33)28-19-21-11-5-3-6-12-21/h3,5-6,9-16,34H,4,7-8,17-20H2,1-2H3,(H,28,33)(H,29,32)
Standard InChI Key: MZVLQECJCSSXJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
18.7005 -4.7463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2960 -5.4562 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.1130 -5.4515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3040 -7.9146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0136 -7.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0108 -6.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3022 -6.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5959 -7.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5982 -6.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8923 -6.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1836 -6.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1853 -7.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8918 -7.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5852 -5.0529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5791 -4.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8806 -5.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1699 -5.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4653 -5.4775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1637 -4.2465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4529 -3.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4468 -3.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1544 -2.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1486 -1.8002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4372 -1.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7303 -1.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7396 -2.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8931 -8.7298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1860 -9.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6014 -9.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2837 -3.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2775 -3.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9821 -2.5908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6929 -2.9940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3975 -2.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3913 -1.7629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1083 -2.9833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8129 -2.5694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
7 2 1 0
2 14 1 0
14 15 1 0
14 16 1 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
13 27 1 0
27 28 1 0
27 29 1 0
15 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.66Molecular Weight (Monoisotopic): 526.2250AlogP: 3.28#Rotatable Bonds: 13Polar Surface Area: 119.05Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.91CX Basic pKa: 4.63CX LogP: 2.83CX LogD: 2.81Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: -1.20
References 1. Raudszus R, Nowotny R, Gertzen CGW, Schöler A, Krizsan A, Gockel I, Kalwa H, Gohlke H, Thieme R, Hansen FK.. (2019) Fluorescent analogs of peptoid-based HDAC inhibitors: Synthesis, biological activity and cellular uptake kinetics., 27 (19): [PMID:31420257 ] [10.1016/j.bmc.2019.07.055 ]