The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-Bis(8-ethyl-5,6-dihydro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxy) propyl diester ID: ALA443736
PubChem CID: 15951053
Max Phase: Preclinical
Molecular Formula: C33H34N6O6
Molecular Weight: 610.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc2c(c1)C(=O)N(C)Cc1c(C(=O)OCCCOC(=O)c3ncn4c3CN(C)C(=O)c3cc(CC)ccc3-4)ncn1-2
Standard InChI: InChI=1S/C33H34N6O6/c1-5-20-8-10-24-22(14-20)30(40)36(3)16-26-28(34-18-38(24)26)32(42)44-12-7-13-45-33(43)29-27-17-37(4)31(41)23-15-21(6-2)9-11-25(23)39(27)19-35-29/h8-11,14-15,18-19H,5-7,12-13,16-17H2,1-4H3
Standard InChI Key: AOQOJIJLIFNFFB-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
6.4014 -9.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0438 -10.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2219 -10.4577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9402 -8.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7602 -9.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1195 -9.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9496 -9.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3032 -9.4327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3098 -8.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7671 -8.2761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9578 -8.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8866 -7.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6520 -6.9365 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1961 -7.5645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1805 -6.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4596 -7.2303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1961 -6.0085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7625 -10.7559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5587 -9.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5079 -11.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7541 -6.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0341 -7.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3600 -9.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0103 -10.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1891 -10.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8916 -8.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7202 -9.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0714 -8.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9115 -9.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2596 -9.4059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2574 -8.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7111 -8.2337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8997 -8.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8196 -7.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5817 -6.8953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1325 -7.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1091 -6.8066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3925 -7.2126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1159 -5.9830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7330 -10.7240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5190 -9.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4817 -11.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3175 -6.7948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3024 -10.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3293 -11.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
21 22 1 0
4 1 1 0
23 24 2 0
2 3 1 0
24 25 1 0
25 27 2 0
5 6 1 0
28 26 2 0
26 23 1 0
6 10 1 0
11 12 2 0
27 28 1 0
28 32 1 0
12 13 1 0
27 29 1 0
13 14 2 0
29 30 1 0
14 10 1 0
33 31 1 0
30 31 1 0
32 33 1 0
3 5 2 0
5 7 1 0
1 2 2 0
15 16 1 0
15 17 2 0
33 34 2 0
34 35 1 0
35 36 2 0
36 32 1 0
12 15 1 0
7 8 1 0
7 18 2 0
37 38 1 0
37 39 2 0
34 37 1 0
6 4 2 0
29 40 2 0
8 19 1 0
30 41 1 0
11 9 1 0
24 42 1 0
2 20 1 0
38 43 1 0
43 22 1 0
8 9 1 0
42 44 1 0
16 21 1 0
20 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 610.67Molecular Weight (Monoisotopic): 610.2540AlogP: 3.76#Rotatable Bonds: 8Polar Surface Area: 128.86Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.17CX LogP: 3.59CX LogD: 3.59Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.22Np Likeness Score: -0.09
References 1. Han D, Holger Försterling F, Li X, Deschamps JR, Parrish D, Cao H, Rallapalli S, Clayton T, Teng Y, Majumder S, Sankar S, Roth BL, Sieghart W, Furtmuller R, Rowlett JK, Weed MR, Cook JM.. (2008) A study of the structure-activity relationship of GABA(A)-benzodiazepine receptor bivalent ligands by conformational analysis with low temperature NMR and X-ray analysis., 16 (19): [PMID:18790643 ] [10.1016/j.bmc.2008.08.072 ]