The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-((4-(2-((2-Aminoethyl)disulfanyl)ethoxy)-3-methoxyphenethyl)amino)-3-(4-((2-isopropoxyethoxy)methyl)phenoxy)propan-2-ol ID: ALA4437569
PubChem CID: 155512746
Max Phase: Preclinical
Molecular Formula: C28H44N2O6S2
Molecular Weight: 568.80
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CCNC[C@H](O)COc2ccc(COCCOC(C)C)cc2)ccc1OCCSSCCN
Standard InChI: InChI=1S/C28H44N2O6S2/c1-22(2)34-14-13-33-20-24-4-7-26(8-5-24)36-21-25(31)19-30-12-10-23-6-9-27(28(18-23)32-3)35-15-17-38-37-16-11-29/h4-9,18,22,25,30-31H,10-17,19-21,29H2,1-3H3/t25-/m0/s1
Standard InChI Key: XZKSUWKPIXBGCI-VWLOTQADSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
20.9097 -10.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1761 -9.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8879 -9.5133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5998 -9.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3075 -9.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0193 -9.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3075 -8.6919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7311 -9.5133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4430 -9.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1548 -9.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4647 -9.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7534 -9.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7529 -10.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4697 -11.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1782 -10.7427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0416 -11.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3292 -10.7465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6221 -11.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1984 -11.1579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4860 -10.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7747 -11.1598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4849 -9.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8633 -9.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8622 -10.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5698 -11.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2777 -10.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2736 -9.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5654 -9.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9791 -9.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9747 -8.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9867 -11.1396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6931 -10.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4021 -11.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1085 -10.7243 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.8175 -11.1307 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.5239 -10.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2329 -11.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9394 -10.7153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 1
6 8 1 0
8 9 1 0
9 10 1 0
2 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 2 1 0
13 16 1 0
16 17 1 0
17 18 1 0
18 1 1 0
1 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
10 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
27 29 1 0
29 30 1 0
26 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.80Molecular Weight (Monoisotopic): 568.2641AlogP: 3.93#Rotatable Bonds: 22Polar Surface Area: 104.43Molecular Species: BASEHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.79CX LogP: 2.99CX LogD: -1.05Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -0.57
References 1. Schwalbe T, Huebner H, Gmeiner P.. (2019) Development of covalent antagonists for β1- and β2-adrenergic receptors., 27 (13): [PMID:31151791 ] [10.1016/j.bmc.2019.05.034 ]