(S)-1-((4-(2-((2-Aminoethyl)disulfanyl)ethoxy)-3-methoxyphenethyl)amino)-3-(4-((2-isopropoxyethoxy)methyl)phenoxy)propan-2-ol

ID: ALA4437569

PubChem CID: 155512746

Max Phase: Preclinical

Molecular Formula: C28H44N2O6S2

Molecular Weight: 568.80

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CCNC[C@H](O)COc2ccc(COCCOC(C)C)cc2)ccc1OCCSSCCN

Standard InChI:  InChI=1S/C28H44N2O6S2/c1-22(2)34-14-13-33-20-24-4-7-26(8-5-24)36-21-25(31)19-30-12-10-23-6-9-27(28(18-23)32-3)35-15-17-38-37-16-11-29/h4-9,18,22,25,30-31H,10-17,19-21,29H2,1-3H3/t25-/m0/s1

Standard InChI Key:  XZKSUWKPIXBGCI-VWLOTQADSA-N

Molfile:  

 
     RDKit          2D

 38 39  0  0  0  0  0  0  0  0999 V2000
   20.9097  -10.7483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1761   -9.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8879   -9.5133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5998   -9.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3075   -9.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0193   -9.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3075   -8.6919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7311   -9.5133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4430   -9.9260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1548   -9.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4647   -9.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7534   -9.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7529  -10.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4697  -11.1530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1782  -10.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0416  -11.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3292  -10.7465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6221  -11.1560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1984  -11.1579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4860  -10.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7747  -11.1598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4849   -9.9289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8633   -9.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8622  -10.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5698  -11.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2777  -10.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2736   -9.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5654   -9.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9791   -9.4995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9747   -8.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9867  -11.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6931  -10.7288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4021  -11.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1085  -10.7243    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.8175  -11.1307    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.5239  -10.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2329  -11.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9394  -10.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  1
  6  8  1  0
  8  9  1  0
  9 10  1  0
  2 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15  2  1  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 18  1  1  0
  1 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 10 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 27 29  1  0
 29 30  1  0
 26 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4437569

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Adrb1 Beta-1 adrenergic receptor (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.80Molecular Weight (Monoisotopic): 568.2641AlogP: 3.93#Rotatable Bonds: 22
Polar Surface Area: 104.43Molecular Species: BASEHBA: 10HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.79CX LogP: 2.99CX LogD: -1.05
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -0.57

References

1. Schwalbe T, Huebner H, Gmeiner P..  (2019)  Development of covalent antagonists for β1- and β2-adrenergic receptors.,  27  (13): [PMID:31151791] [10.1016/j.bmc.2019.05.034]

Source