2-(3-Benzyl-4-oxo-3,4,5,6,7,8-hexahydro-benzo[4,5]thieno[2,3-d]pyrimidin-2-ylsulfanylmethyl)-oxazole-4-carboxylic acid(2-cyclopentyl-ethyl)-amide

ID: ALA4437830

PubChem CID: 155512580

Max Phase: Preclinical

Molecular Formula: C29H32N4O3S2

Molecular Weight: 548.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCCC1CCCC1)c1coc(CSc2nc3sc4c(c3c(=O)n2Cc2ccccc2)CCCC4)n1

Standard InChI:  InChI=1S/C29H32N4O3S2/c34-26(30-15-14-19-8-4-5-9-19)22-17-36-24(31-22)18-37-29-32-27-25(21-12-6-7-13-23(21)38-27)28(35)33(29)16-20-10-2-1-3-11-20/h1-3,10-11,17,19H,4-9,12-16,18H2,(H,30,34)

Standard InChI Key:  QLVFGUOVCYGXRO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   15.4129   -5.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4129   -6.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1249   -6.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1249   -4.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8370   -5.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8415   -6.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6285   -6.4104    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.6211   -5.0740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1078   -5.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9225   -5.6504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2568   -4.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7702   -4.2330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9491   -4.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4610   -3.6554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0772   -4.8100    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.1039   -3.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9242   -3.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4087   -4.0561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2283   -3.9683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5627   -3.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0715   -2.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2536   -2.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5635   -5.4765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3838   -5.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9379   -5.9998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6908   -5.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6029   -4.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7955   -4.6725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2148   -4.2889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0001   -4.5422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0416   -3.4823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6120   -3.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3971   -4.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0090   -3.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8156   -3.8617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2266   -3.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6731   -2.5345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9203   -2.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 11 15  1  0
 12 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 15 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  2  0
 27 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4437830

    ---

Associated Targets(Human)

HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

MEF (1005 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 548.73Molecular Weight (Monoisotopic): 548.1916AlogP: 5.98#Rotatable Bonds: 9
Polar Surface Area: 90.02Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.26CX Basic pKa: 2.29CX LogP: 6.55CX LogD: 6.55
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -1.99

References

1. Nguyen J, Chen L, Kumar D, Lee J..  (2016)  Facile synthesis of autophagonizer and evaluation of its activity to induce autophagic cell death in apoptosis-defective cell line.,  26  (19): [PMID:27597252] [10.1016/j.bmcl.2016.08.035]

Source