4-((3,4-Dihydrothiopyrano[4,3-b]indol-5(1H)-yl)methyl)-N-hydroxybenzamide

ID: ALA4438279

PubChem CID: 71582992

Max Phase: Preclinical

Molecular Formula: C19H18N2O2S

Molecular Weight: 338.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NO)c1ccc(Cn2c3c(c4ccccc42)CSCC3)cc1

Standard InChI:  InChI=1S/C19H18N2O2S/c22-19(20-23)14-7-5-13(6-8-14)11-21-17-4-2-1-3-15(17)16-12-24-10-9-18(16)21/h1-8,23H,9-12H2,(H,20,22)

Standard InChI Key:  NAHIKSGGBQEYMV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   12.6279  -28.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6268  -29.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3348  -29.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0445  -29.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0416  -28.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3330  -27.8337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7528  -29.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7541  -30.2863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4599  -29.0594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1682  -29.4669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9201  -27.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9199  -27.0170    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3277  -25.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5789  -26.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3708  -26.7028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9172  -26.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6660  -25.3255    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.8684  -25.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2582  -26.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5113  -25.7637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9687  -25.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1729  -25.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9226  -26.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4668  -26.7061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
  1 11  1  0
 11 12  1  0
 12 14  1  0
 13 20  1  0
 19 12  1  0
 13 14  2  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
M  END

Associated Targets(Human)

HDAC10 Tclin Histone deacetylase 10 (801 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HDAC6 Tclin Histone deacetylase 6 (20808 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 338.43Molecular Weight (Monoisotopic): 338.1089AlogP: 3.60#Rotatable Bonds: 3
Polar Surface Area: 54.26Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.20CX Basic pKa: CX LogP: 3.37CX LogD: 3.36
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.57Np Likeness Score: -0.96

References

1. Géraldy M, Morgen M, Sehr P, Steimbach RR, Moi D, Ridinger J, Oehme I, Witt O, Malz M, Nogueira MS, Koch O, Gunkel N, Miller AK..  (2019)  Selective Inhibition of Histone Deacetylase 10: Hydrogen Bonding to the Gatekeeper Residue is Implicated.,  62  (9): [PMID:30964290] [10.1021/acs.jmedchem.8b01936]

Source