The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Ethyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)-N'-[4-(4-nitrophenyl)-3H-thiazol-2-ylidene]hydrazine ID: ALA4438416
PubChem CID: 155513343
Max Phase: Preclinical
Molecular Formula: C22H17N7O2S2
Molecular Weight: 475.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn2c(/C=N/N=c3/[nH]c(-c4ccc([N+](=O)[O-])cc4)cs3)c(-c3ccccc3)nc2s1
Standard InChI: InChI=1S/C22H17N7O2S2/c1-2-19-27-28-18(20(25-22(28)33-19)15-6-4-3-5-7-15)12-23-26-21-24-17(13-32-21)14-8-10-16(11-9-14)29(30)31/h3-13H,2H2,1H3,(H,24,26)/b23-12+
Standard InChI Key: XKDQXFUGYXRQRV-FSJBWODESA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
22.4071 -17.8589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3886 -16.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9166 -17.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1816 -16.7622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1908 -17.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9809 -17.8398 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.4617 -17.1640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9661 -16.4991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0938 -17.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6687 -16.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8421 -16.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4396 -17.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8656 -17.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6908 -17.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1226 -15.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3105 -15.5749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0444 -14.7916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2367 -14.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8908 -13.8867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0732 -13.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9128 -14.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6313 -15.1934 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.2850 -17.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7046 -17.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5159 -13.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7615 -12.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2032 -11.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3993 -12.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1566 -12.9636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7166 -13.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8371 -11.5691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0343 -11.7521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0799 -10.7824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
7 23 1 0
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
20 25 1 0
31 32 2 0
31 33 1 0
28 31 1 0
M CHG 2 31 1 33 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.56Molecular Weight (Monoisotopic): 475.0885AlogP: 4.92#Rotatable Bonds: 6Polar Surface Area: 113.84Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.37CX Basic pKa: 2.80CX LogP: 5.06CX LogD: 5.02Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.21Np Likeness Score: -2.07
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]