N-(2-Ethyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene)-N'-[4-(4-nitrophenyl)-3H-thiazol-2-ylidene]hydrazine

ID: ALA4438416

PubChem CID: 155513343

Max Phase: Preclinical

Molecular Formula: C22H17N7O2S2

Molecular Weight: 475.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1nn2c(/C=N/N=c3/[nH]c(-c4ccc([N+](=O)[O-])cc4)cs3)c(-c3ccccc3)nc2s1

Standard InChI:  InChI=1S/C22H17N7O2S2/c1-2-19-27-28-18(20(25-22(28)33-19)15-6-4-3-5-7-15)12-23-26-21-24-17(13-32-21)14-8-10-16(11-9-14)29(30)31/h3-13H,2H2,1H3,(H,24,26)/b23-12+

Standard InChI Key:  XKDQXFUGYXRQRV-FSJBWODESA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   22.4071  -17.8589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3886  -16.5173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9166  -17.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1816  -16.7622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1908  -17.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9809  -17.8398    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.4617  -17.1640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9661  -16.4991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0938  -17.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6687  -16.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8421  -16.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4396  -17.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8656  -17.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6908  -17.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1226  -15.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3105  -15.5749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0444  -14.7916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2367  -14.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8908  -13.8867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0732  -13.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9128  -14.7914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6313  -15.1934    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.2850  -17.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7046  -17.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5159  -13.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7615  -12.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2032  -11.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3993  -12.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1566  -12.9636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7166  -13.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8371  -11.5691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0343  -11.7521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0799  -10.7824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
  7 23  1  0
 23 24  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 20 25  1  0
 31 32  2  0
 31 33  1  0
 28 31  1  0
M  CHG  2  31   1  33  -1
M  END

Alternative Forms

  1. Parent:

    ALA4438416

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.56Molecular Weight (Monoisotopic): 475.0885AlogP: 4.92#Rotatable Bonds: 6
Polar Surface Area: 113.84Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.37CX Basic pKa: 2.80CX LogP: 5.06CX LogD: 5.02
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.21Np Likeness Score: -2.07

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source