N-[5-cyclohexylmethyl-4-(4-hydroxyphenyl)thiazol-2-yl]-3,4,5-trihydroxybenzamide

ID: ALA4438457

PubChem CID: 57991635

Max Phase: Preclinical

Molecular Formula: C23H24N2O5S

Molecular Weight: 440.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1nc(-c2ccc(O)cc2)c(CC2CCCCC2)s1)c1cc(O)c(O)c(O)c1

Standard InChI:  InChI=1S/C23H24N2O5S/c26-16-8-6-14(7-9-16)20-19(10-13-4-2-1-3-5-13)31-23(24-20)25-22(30)15-11-17(27)21(29)18(28)12-15/h6-9,11-13,26-29H,1-5,10H2,(H,24,25,30)

Standard InChI Key:  IZVKRXXSLXDODF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    5.2622   -5.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0794   -5.1591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3337   -4.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6708   -3.9002    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0120   -4.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1113   -4.1309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2347   -4.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0645   -3.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6757   -2.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5081   -1.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7318   -1.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1227   -2.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2900   -3.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7815   -5.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9680   -5.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4869   -6.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8183   -7.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6354   -7.2205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1128   -6.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3380   -7.7974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7178   -4.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4954   -4.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5468   -5.4777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0978   -4.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8747   -4.7260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0464   -3.9261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4349   -3.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6604   -3.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4810   -5.2739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8236   -3.6736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6031   -2.5779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  1 14  1  0
 17 20  1  0
  6 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 22  1  0
 25 29  1  0
 26 30  1  0
 27 31  1  0
M  END

Associated Targets(Human)

PLTP Tbio Phospholipid transfer protein (94 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CETP Tchem Cholesteryl ester transfer protein (2422 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 440.52Molecular Weight (Monoisotopic): 440.1406AlogP: 5.01#Rotatable Bonds: 5
Polar Surface Area: 122.91Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.08CX Basic pKa: CX LogP: 5.92CX LogD: 5.84
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: -0.56

References

1.  (2014)  2,4,5-trisubstituted thiazole compounds,preparation methods,pharmaceutical compositions and medical uses thereof, 
2.  (2016)  2,4,5-trisubstituted thiazole compounds,preparation methods,pharmaceutical compositions and medical uses thereof, 

Source