The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Urundeuvine E ID: ALA4438688
PubChem CID: 155513164
Max Phase: Preclinical
Molecular Formula: C30H24O10
Molecular Weight: 544.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(O)cc1O)[C@H]1[C@H](c2ccc(O)cc2)c2cc(O)c(O)cc2[C@H](O)[C@]1(O)C(=O)c1ccc(O)cc1
Standard InChI: InChI=1S/C30H24O10/c31-16-5-1-14(2-6-16)25-20-12-23(35)24(36)13-21(20)29(39)30(40,28(38)15-3-7-17(32)8-4-15)26(25)27(37)19-10-9-18(33)11-22(19)34/h1-13,25-26,29,31-36,39-40H/t25-,26-,29+,30-/m1/s1
Standard InChI Key: SAGAVEAZOJMRGU-SXBXJLEOSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
16.7350 -4.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7315 -5.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4335 -5.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1408 -5.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4405 -4.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1428 -4.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8502 -4.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8566 -3.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1496 -2.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4451 -3.2265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5667 -2.8306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4312 -6.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1378 -6.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7224 -6.8953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9564 -5.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3643 -5.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1791 -5.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5857 -5.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1716 -4.5522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3581 -4.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1341 -7.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8398 -8.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5497 -7.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5494 -6.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8431 -6.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1527 -2.0057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4248 -8.1207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2568 -8.1284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4029 -5.2563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0220 -5.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3161 -5.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0186 -6.4850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7235 -6.0753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0280 -4.0351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3222 -4.4402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6171 -4.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9067 -4.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9058 -5.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6116 -5.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2002 -4.0236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 5 1 0
2 3 1 0
3 4 1 0
6 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
3 12 1 6
12 13 1 0
12 14 2 0
4 15 1 1
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 13 1 0
9 26 1 0
21 27 1 0
23 28 1 0
18 29 1 0
2 30 1 0
30 31 1 0
30 32 2 0
2 33 1 6
1 34 1 1
31 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 31 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.51Molecular Weight (Monoisotopic): 544.1369AlogP: 3.21#Rotatable Bonds: 5Polar Surface Area: 195.98Molecular Species: NEUTRALHBA: 10HBD: 8#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.43CX Basic pKa: ┄CX LogP: 3.96CX LogD: 3.63Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.14Np Likeness Score: 0.79
References 1. Menezes JCJMDS, Diederich MF.. (2019) Natural dimers of coumarin, chalcones, and resveratrol and the link between structure and pharmacology., 182 [PMID:31494471 ] [10.1016/j.ejmech.2019.111637 ]