Urundeuvine E

ID: ALA4438688

PubChem CID: 155513164

Max Phase: Preclinical

Molecular Formula: C30H24O10

Molecular Weight: 544.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(O)cc1O)[C@H]1[C@H](c2ccc(O)cc2)c2cc(O)c(O)cc2[C@H](O)[C@]1(O)C(=O)c1ccc(O)cc1

Standard InChI:  InChI=1S/C30H24O10/c31-16-5-1-14(2-6-16)25-20-12-23(35)24(36)13-21(20)29(39)30(40,28(38)15-3-7-17(32)8-4-15)26(25)27(37)19-10-9-18(33)11-22(19)34/h1-13,25-26,29,31-36,39-40H/t25-,26-,29+,30-/m1/s1

Standard InChI Key:  SAGAVEAZOJMRGU-SXBXJLEOSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   16.7350   -4.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7315   -5.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4335   -5.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1408   -5.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4405   -4.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1428   -4.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8502   -4.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8566   -3.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1496   -2.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4451   -3.2265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5667   -2.8306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4312   -6.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1378   -6.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7224   -6.8953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9564   -5.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3643   -5.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1791   -5.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5857   -5.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1716   -4.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3581   -4.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1341   -7.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8398   -8.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5497   -7.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5494   -6.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8431   -6.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1527   -2.0057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4248   -8.1207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2568   -8.1284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4029   -5.2563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0220   -5.6678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3161   -5.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0186   -6.4850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7235   -6.0753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0280   -4.0351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3222   -4.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6171   -4.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9067   -4.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9058   -5.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6116   -5.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2002   -4.0236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  5  1  0
  2  3  1  0
  3  4  1  0
  6  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
  3 12  1  6
 12 13  1  0
 12 14  2  0
  4 15  1  1
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 13  1  0
  9 26  1  0
 21 27  1  0
 23 28  1  0
 18 29  1  0
  2 30  1  0
 30 31  1  0
 30 32  2  0
  2 33  1  6
  1 34  1  1
 31 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 31  1  0
 37 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4438688

    ---

Associated Targets(Human)

CTSV Tchem Cathepsin L2 (273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.51Molecular Weight (Monoisotopic): 544.1369AlogP: 3.21#Rotatable Bonds: 5
Polar Surface Area: 195.98Molecular Species: NEUTRALHBA: 10HBD: 8
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.43CX Basic pKa: CX LogP: 3.96CX LogD: 3.63
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.14Np Likeness Score: 0.79

References

1. Menezes JCJMDS, Diederich MF..  (2019)  Natural dimers of coumarin, chalcones, and resveratrol and the link between structure and pharmacology.,  182  [PMID:31494471] [10.1016/j.ejmech.2019.111637]

Source