The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-(E)-1-(1-(but-2-enoyl)piperidin-3-yl)-3-(4-phenoxyphenyl)-1H-pyrazole-5-carboxylic acid ID: ALA4439058
PubChem CID: 155513697
Max Phase: Preclinical
Molecular Formula: C25H25N3O4
Molecular Weight: 431.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3)cc2C(=O)O)C1
Standard InChI: InChI=1S/C25H25N3O4/c1-2-7-24(29)27-15-6-8-19(17-27)28-23(25(30)31)16-22(26-28)18-11-13-21(14-12-18)32-20-9-4-3-5-10-20/h2-5,7,9-14,16,19H,6,8,15,17H2,1H3,(H,30,31)/b7-2+
Standard InChI Key: MUOKQSQWTQNUGP-FARCUNLSSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
3.9611 -17.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6343 -17.7453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2970 -17.2538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0321 -16.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2081 -16.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6404 -18.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9287 -18.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9357 -19.8116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6529 -20.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3646 -19.8009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3592 -18.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5077 -15.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3303 -15.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8058 -15.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4600 -14.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6339 -14.3772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1620 -15.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9348 -13.7752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7565 -13.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0994 -14.6015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9204 -14.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3961 -14.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0449 -13.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2251 -13.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0822 -20.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0885 -21.0329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7936 -19.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5111 -20.1970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1793 -17.5320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5602 -16.9868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2225 -19.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0165 -18.3409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
6 2 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
4 12 1 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
10 25 1 0
25 26 2 0
25 27 1 0
27 28 2 0
1 29 1 0
29 30 1 0
28 31 1 0
29 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.49Molecular Weight (Monoisotopic): 431.1845AlogP: 4.78#Rotatable Bonds: 6Polar Surface Area: 84.66Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.47CX Basic pKa: 1.12CX LogP: 4.37CX LogD: 0.98Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: -0.84
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]