The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-ethyl-3-(3-(4-methoxybenzylideneamino)-1H-1,2,4-triazol-5-yl)-7-methyl-1,8-naphthyridin-4(1H)-one ID: ALA4439286
PubChem CID: 155513914
Max Phase: Preclinical
Molecular Formula: C21H20N6O2
Molecular Weight: 388.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(-c2nc(/N=C/c3ccc(OC)cc3)n[nH]2)c(=O)c2ccc(C)nc21
Standard InChI: InChI=1S/C21H20N6O2/c1-4-27-12-17(18(28)16-10-5-13(2)23-20(16)27)19-24-21(26-25-19)22-11-14-6-8-15(29-3)9-7-14/h5-12H,4H2,1-3H3,(H,24,25,26)/b22-11+
Standard InChI Key: QNRKZWUPQPBJBH-SSDVNMTOSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
13.1273 -4.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1262 -5.1613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8342 -5.5703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8324 -3.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5410 -4.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5418 -5.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2503 -5.5643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9586 -5.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9539 -4.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2447 -3.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4181 -5.5694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2520 -6.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5452 -6.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2404 -3.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6582 -3.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4067 -4.2439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9498 -3.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5369 -2.9280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7387 -3.1029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7665 -3.6320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1740 -2.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9912 -2.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3999 -3.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2163 -3.6300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6246 -2.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2105 -2.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3954 -2.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4418 -2.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8524 -3.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 1 0
2 11 1 0
7 12 1 0
12 13 1 0
10 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
9 15 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.43Molecular Weight (Monoisotopic): 388.1648AlogP: 3.27#Rotatable Bonds: 5Polar Surface Area: 98.05Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.84CX Basic pKa: 4.73CX LogP: 3.71CX LogD: 3.08Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -1.14
References 1. Zhang J, Wang S, Ba Y, Xu Z.. (2019) 1,2,4-Triazole-quinoline/quinolone hybrids as potential anti-bacterial agents., 174 [PMID:31015103 ] [10.1016/j.ejmech.2019.04.033 ] 2. Aggarwal R, Sumran G.. (2020) An insight on medicinal attributes of 1,2,4-triazoles., 205 [PMID:32771798 ] [10.1016/j.ejmech.2020.112652 ]