The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4S)-4-((S)-2-Acetamidopropanamido)-5-(((2S)-1-(2-carbamoylpyrrolidin-1-yl)-4-(methylthio)-1-oxobutan-2-yl)-amino)-5-oxopentanoic Acid ID: ALA4439489
PubChem CID: 155513998
Max Phase: Preclinical
Molecular Formula: C20H33N5O7S
Molecular Weight: 487.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(C)=O)C(=O)N1CCC[C@H]1C(N)=O
Standard InChI: InChI=1S/C20H33N5O7S/c1-11(22-12(2)26)18(30)23-13(6-7-16(27)28)19(31)24-14(8-10-33-3)20(32)25-9-4-5-15(25)17(21)29/h11,13-15H,4-10H2,1-3H3,(H2,21,29)(H,22,26)(H,23,30)(H,24,31)(H,27,28)/t11-,13-,14-,15-/m0/s1
Standard InChI Key: OZJPHPFUKQQRTO-MXAVVETBSA-N
Molfile:
RDKit 2D
33 33 0 0 0 0 0 0 0 0999 V2000
17.3165 -14.4877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6071 -14.0791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3165 -12.8533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9019 -14.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6071 -13.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9019 -12.8533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9019 -12.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6071 -10.8103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6071 -11.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1924 -11.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4872 -12.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7778 -11.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7778 -10.8103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0684 -12.0361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3165 -12.0361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0259 -11.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4406 -11.6275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7312 -12.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0259 -10.8103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7312 -10.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7312 -9.5846 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.0259 -9.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7312 -12.8533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3938 -13.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3837 -12.2912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1708 -13.0831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1384 -14.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0704 -13.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3227 -14.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7497 -13.6620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3165 -15.3049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0259 -15.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6071 -15.7135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
9 15 1 0
18 23 1 0
26 30 1 0
1 2 1 0
2 5 1 0
5 3 2 0
2 4 1 1
7 6 1 1
7 9 1 0
9 8 2 0
7 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
15 16 1 0
16 18 1 0
18 17 2 0
16 19 1 1
19 20 1 0
20 21 1 0
21 22 1 0
23 24 1 0
24 26 1 6
26 25 2 0
24 27 1 0
28 29 1 0
29 27 1 0
28 23 1 0
1 31 1 0
31 32 1 0
31 33 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.58Molecular Weight (Monoisotopic): 487.2101AlogP: -1.43#Rotatable Bonds: 13Polar Surface Area: 188.00Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.96CX Basic pKa: ┄CX LogP: -2.61CX LogD: -5.79Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.21Np Likeness Score: -0.39
References 1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A.. (2018) Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model., 61 (24): [PMID:30507195 ] [10.1021/acs.jmedchem.8b01471 ]