The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-({4-oxo-3-[4-(2,2,2-trifluoroethoxy)[2,6-3H2]phenyl]-3,4-dihydrothieno[3,4-d]pyrimidin-2-yl}sulfanyl)ethyl]acetamide ID: ALA4439992
Cas Number: 1356354-09-0
PubChem CID: 86685411
Product Number: T286634, Order Now?
Max Phase: Preclinical
Molecular Formula: C18H16F3N3O3S2
Molecular Weight: 443.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NCCSc1nc2cscc2c(=O)n1-c1ccc(OCC(F)(F)F)cc1
Standard InChI: InChI=1S/C18H16F3N3O3S2/c1-11(25)22-6-7-29-17-23-15-9-28-8-14(15)16(26)24(17)12-2-4-13(5-3-12)27-10-18(19,20)21/h2-5,8-9H,6-7,10H2,1H3,(H,22,25)
Standard InChI Key: BVRXQXNVDLUWMV-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
2.7869 -10.5581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4990 -10.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4990 -9.3248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7869 -8.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2110 -8.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9245 -9.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6397 -8.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6425 -8.0973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9242 -7.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2120 -8.0949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0750 -10.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0704 -9.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2800 -9.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7961 -9.7421 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2875 -10.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7901 -8.0832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2128 -10.5634 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.9279 -10.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -10.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3567 -10.1539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0707 -10.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7857 -10.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0695 -11.3924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3577 -7.6859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0714 -8.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7866 -7.6882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5004 -8.1018 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.7879 -6.8632 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.4957 -7.2707 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12 4 1 0
11 1 1 0
1 2 2 0
2 3 1 0
3 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 5 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 11 2 0
4 16 2 0
2 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
8 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.47Molecular Weight (Monoisotopic): 443.0585AlogP: 3.62#Rotatable Bonds: 7Polar Surface Area: 73.22Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.59CX LogP: 3.37CX LogD: 3.37Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.34Np Likeness Score: -1.92
References 1. Miyahisa I, Suzuki H, Mizukami A, Tanaka Y, Ono M, Hixon MS, Matsui J.. (2016) T-3364366 Targets the Desaturase Domain of Delta-5 Desaturase with Nanomolar Potency and a Multihour Residence Time., 7 (9): [PMID:27660693 ] [10.1021/acsmedchemlett.6b00241 ] 2. Miyahisa I, Suzuki H, Mizukami A, Tanaka Y, Ono M, Hixon MS, Matsui J.. (2016) T-3364366 Targets the Desaturase Domain of Delta-5 Desaturase with Nanomolar Potency and a Multihour Residence Time., 7 (9): [PMID:27660693 ] [10.1021/acsmedchemlett.6b00241 ]