(4S)-4-[[(2S)-6-amino-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxy-butanoyl]amino]-4-methyl-pentanoyl]amino]hexanoyl]amino]-5-[[(1S)-5-amino-1-[[(1S)-1-[[(1S,2S)-1-carbamoyl-2-methyl-butyl]carbamoyl]-3-methyl-butyl]carbamoyl]pentyl]amino]-5-oxo-pentanoic acid

ID: ALA4440124

PubChem CID: 155514373

Max Phase: Preclinical

Molecular Formula: C42H79N11O11

Molecular Weight: 914.16

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](C)N)[C@@H](C)O)C(N)=O

Standard InChI: InChI=1S/C42H79N11O11/c1-9-24(6)33(35(46)57)52-41(63)31(21-23(4)5)50-38(60)28(15-11-13-19-44)47-39(61)29(16-17-32(55)56)49-37(59)27(14-10-12-18-43)48-40(62)30(20-22(2)3)51-42(64)34(26(8)54)53-36(58)25(7)45/h22-31,33-34,54H,9-21,43-45H2,1-8H3,(H2,46,57)(H,47,61)(H,48,62)(H,49,59)(H,50,60)(H,51,64)(H,52,63)(H,53,58)(H,55,56)/t24-,25-,26+,27-,28-,29-,30-,31-,33-,34-/m0/s1

Standard InChI Key: VMBMBSRGWYKZRT-VADOWIHESA-N

Molfile:

 
     RDKit          2D

 64 63  0  0  0  0  0  0  0  0999 V2000
    3.0294   -5.3283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7371   -4.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4448   -5.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1525   -4.9197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4448   -6.1454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8602   -5.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5679   -4.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2756   -5.3283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5679   -4.1025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9833   -4.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6911   -5.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3988   -4.9197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6911   -6.1454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1065   -5.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8142   -4.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5219   -5.3283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8142   -4.1025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2296   -4.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9373   -5.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6450   -4.9197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9373   -6.1454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3527   -5.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0604   -4.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7681   -5.3282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0604   -4.1025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4758   -4.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1836   -5.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8913   -4.9197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1836   -6.1454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5990   -5.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3067   -4.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3067   -4.1025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7371   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8602   -6.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1525   -6.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5679   -6.5540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9833   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6911   -3.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6911   -2.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3988   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1065   -6.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3527   -6.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5990   -6.1454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8142   -6.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8142   -7.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5219   -7.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5219   -8.5970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2296   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4758   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9373   -3.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9373   -2.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6450   -2.4681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2296   -2.4681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0604   -6.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0604   -7.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7681   -7.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7681   -8.5970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1836   -3.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1836   -2.8767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8913   -4.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8913   -6.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8913   -7.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0144   -5.3282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3067   -6.5540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  6  4  1  6
  6  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 30 28  1  6
 30 31  1  0
 31 32  2  0
  2 33  1  1
  6 34  1  0
 34 35  1  0
 34 36  1  6
 10 37  1  1
 37 38  1  0
 38 39  1  0
 38 40  1  0
 14 41  1  6
 22 42  1  6
 30 43  1  0
 41 44  1  0
 44 45  1  0
 45 46  1  0
 46 47  1  0
 18 48  1  1
 26 49  1  1
 48 50  1  0
 50 51  1  0
 51 52  2  0
 51 53  1  0
 42 54  1  0
 54 55  1  0
 55 56  1  0
 56 57  1  0
 49 58  1  0
 58 59  1  0
 58 60  1  0
 43 61  1  0
 61 62  1  0
 31 63  1  0
 43 64  1  1
M  END

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Unknown	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 914.16	Molecular Weight (Monoisotopic): 913.5961	AlogP: -2.15	#Rotatable Bonds: 33
Polar Surface Area: 382.38	Molecular Species: ZWITTERION	HBA: 13	HBD: 13
#RO5 Violations: 3	HBA (Lipinski): 22	HBD (Lipinski): 17	#RO5 Violations (Lipinski): 3
CX Acidic pKa: 4.00	CX Basic pKa: 13.37	CX LogP: -5.14	CX LogD: -7.97
Aromatic Rings: ┄	Heavy Atoms: 64	QED Weighted: 0.03	Np Likeness Score: 0.24

References

1. Thabault L, Brisson L, Brustenga C, Martinez Gache SA, Prévost JRC, Kozlova A, Spillier Q, Liberelle M, Benyahia Z, Messens J, Copetti T, Sonveaux P, Frédérick R.. (2020) Interrogating the Lactate Dehydrogenase Tetramerization Site Using (Stapled) Peptides., 63 (9): [PMID:32250117] [10.1021/acs.jmedchem.9b01955]

(4S)-4-[[(2S)-6-amino-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxy-butanoyl]amino]-4-methyl-pentanoyl]amino]hexanoyl]amino]-5-[[(1S)-5-amino-1-[[(1S)-1-[[(1S,2S)-1-carbamoyl-2-methyl-butyl]carbamoyl]-3-methyl-butyl]carbamoyl]pentyl]amino]-5-oxo-pentanoic acid

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Associated Targets(non-human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source