The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((Dimethylamino)methyl)-1H-1,2,3-triazol-1-yl)-N-(7-(4-(pyridin-3-yl)-1H-1,2,3-triazol-1-yl)heptyl)benzamide ID: ALA4440197
PubChem CID: 155514364
Max Phase: Preclinical
Molecular Formula: C26H33N9O
Molecular Weight: 487.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)Cc1cn(-c2ccccc2C(=O)NCCCCCCCn2cc(-c3cccnc3)nn2)nn1
Standard InChI: InChI=1S/C26H33N9O/c1-33(2)18-22-19-35(32-29-22)25-13-7-6-12-23(25)26(36)28-15-8-4-3-5-9-16-34-20-24(30-31-34)21-11-10-14-27-17-21/h6-7,10-14,17,19-20H,3-5,8-9,15-16,18H2,1-2H3,(H,28,36)
Standard InChI Key: LWWFFIWBIHPLNW-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
2.5263 -14.4671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3501 -14.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7591 -13.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3496 -13.0462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5227 -13.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1133 -13.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5878 -13.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0747 -14.4218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8601 -14.1681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8603 -13.3426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0750 -13.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5670 -12.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2859 -13.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9979 -12.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7168 -13.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4288 -12.9028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1478 -13.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8599 -12.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5787 -13.2957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2867 -12.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0055 -13.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2797 -12.0537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0095 -14.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7275 -14.5188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4406 -14.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4310 -13.2682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7125 -12.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7010 -12.0407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3567 -11.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0930 -10.7719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2705 -10.7833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0244 -11.5692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8059 -10.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5207 -10.7591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5277 -11.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2327 -10.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
3 7 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 28 1 0
30 33 1 0
33 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.61Molecular Weight (Monoisotopic): 487.2808AlogP: 3.36#Rotatable Bonds: 13Polar Surface Area: 106.65Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.50CX LogP: 3.35CX LogD: 3.30Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.77
References 1. Travelli C, Aprile S, Mattoteia D, Colombo G, Clemente N, Scanziani E, Terrazzino S, Alisi MA, Polenzani L, Grosa G, Genazzani AA, Tron GC, Galli U.. (2019) Identification of potent triazolylpyridine nicotinamide phosphoribosyltransferase (NAMPT) inhibitors bearing a 1,2,3-triazole tail group., 181 [PMID:31400709 ] [10.1016/j.ejmech.2019.111576 ]