2',3'-O-isopropylidenadenosine-4'-(glutamic acid)carboxamide

ID: ALA4440260

PubChem CID: 155514310

Max Phase: Preclinical

Molecular Formula: C18H22N6O8

Molecular Weight: 450.41

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC1(C)O[C@@H]2[C@H](O1)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)O[C@H]2n1cnc2c(N)ncnc21

Standard InChI:  InChI=1S/C18H22N6O8/c1-18(2)31-10-11(15(27)23-7(17(28)29)3-4-8(25)26)30-16(12(10)32-18)24-6-22-9-13(19)20-5-21-14(9)24/h5-7,10-12,16H,3-4H2,1-2H3,(H,23,27)(H,25,26)(H,28,29)(H2,19,20,21)/t7-,10+,11-,12+,16+/m0/s1

Standard InChI Key:  SZCHMKMPWUDZBK-JISRJMKVSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   43.7581  -21.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3498  -21.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9369  -21.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9409  -19.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2565  -18.7367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6070  -19.2452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7159  -18.9142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.0469  -18.8641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.3963  -19.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8136  -19.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9393  -18.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7623  -18.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1497  -17.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7151  -16.6694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.8892  -16.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5056  -17.4242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.9743  -17.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.7144  -19.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8932  -20.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6690  -20.8122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9976  -20.7618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.0693  -20.0661    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   44.5391  -19.9657    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.6131  -18.2184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.2208  -19.5925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4274  -19.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2269  -18.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8199  -17.9918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4336  -18.3390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.8345  -19.9397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0412  -19.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4483  -20.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6549  -20.0604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.6488  -21.0873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
 18  4  1  0
  4  5  1  0
  5  6  1  0
  6 19  1  0
  4  7  1  1
  7  9  1  0
  8 12  1  0
 11  7  1  0
  8  9  2  0
  6 10  1  1
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 13 17  1  0
 18 19  1  0
 19 20  1  0
 20  2  1  0
  2 21  1  0
 21 18  1  0
 19 22  1  1
 18 23  1  1
 10 24  2  0
 10 25  1  0
 25 26  1  0
 26 27  1  1
 27 28  2  0
 27 29  1  0
 26 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA4440260

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 450.41

Molecular Weight (Monoisotopic): 450.1499

AlogP: -0.74

#Rotatable Bonds: 7

Polar Surface Area: 201.01

Molecular Species: ACID

HBA: 11

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 14

HBD (Lipinski): 5

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 3.22

CX Basic pKa: 4.96

CX LogP: -2.24

CX LogD: -7.63

Aromatic Rings: 2

Heavy Atoms: 32

QED Weighted: 0.41

Np Likeness Score: 0.57

References

1. Dal Ben D, Buccioni M, Lambertucci C, Marucci G, Spinaci A, Marchenkova A, Abdelrahman A, Nistri A, Müller CE, Volpini R..  (2019)  Investigation on 2',3'-O-Substituted ATP Derivatives and Analogs as Novel P2X3 Receptor Antagonists.,  10  (4): [PMID:30996785] [10.1021/acsmedchemlett.8b00524]

Source

Source(1):

• Scientific Literature