2',4,4'-trihydroxy-6'-methoxy-3'(3''-hydroxybenzyl)dihydrochalcone

ID: ALA4440378

PubChem CID: 155514405

Max Phase: Preclinical

Molecular Formula: C23H20O6

Molecular Weight: 392.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(O)c(Cc2ccccc2O)c(O)c1C(=O)/C=C/c1ccc(O)cc1

Standard InChI:  InChI=1S/C23H20O6/c1-29-21-13-20(27)17(12-15-4-2-3-5-18(15)25)23(28)22(21)19(26)11-8-14-6-9-16(24)10-7-14/h2-11,13,24-25,27-28H,12H2,1H3/b11-8+

Standard InChI Key:  PUVDYELVPACRFH-DHZHZOJOSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    5.5084  -11.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5073  -12.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2153  -12.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9250  -12.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9222  -11.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2135  -10.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6333  -12.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6346  -13.4307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3404  -12.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3391  -11.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0462  -10.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7522  -11.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4587  -10.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4579  -10.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7446   -9.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0409  -10.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2151  -13.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8006  -10.9786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6283  -10.9721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6252  -10.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1644   -9.7477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7993  -12.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7986  -13.4317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0905  -13.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0895  -14.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7974  -15.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5078  -14.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5053  -13.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3835  -13.4283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  3 17  1  0
  1 18  1  0
  5 19  1  0
 19 20  1  0
 14 21  1  0
  2 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 24 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4440378

    ---

Associated Targets(non-human)

Rela Transcription factor p65 (175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.41Molecular Weight (Monoisotopic): 392.1260AlogP: 4.00#Rotatable Bonds: 6
Polar Surface Area: 107.22Molecular Species: ACIDHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 5.55CX Basic pKa: CX LogP: 5.26CX LogD: 3.57
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.37Np Likeness Score: 1.01

References

1. Jaidee W, Andersen RJ, Chavez MAG, Wang YA, Patrick BO, Pyne SG, Muanprasat C, Borwornpinyo S, Laphookhieo S..  (2019)  Amides and Flavonoids from the Fruit and Leaf Extracts of Melodorum siamensis.,  82  (2): [PMID:30694059] [10.1021/acs.jnatprod.8b00696]

Source