N-[4-[Ethyl(isopropyl)amino]phenyl]-3-methyl-5-(4-methyl-1,2,3-thiadiazol-5-yl)isoxazole-4-carboxamide

ID: ALA4440900

PubChem CID: 155514598

Max Phase: Preclinical

Molecular Formula: C19H23N5O2S

Molecular Weight: 385.49

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(c1ccc(NC(=O)c2c(C)noc2-c2snnc2C)cc1)C(C)C

Standard InChI:  InChI=1S/C19H23N5O2S/c1-6-24(11(2)3)15-9-7-14(8-10-15)20-19(25)16-12(4)22-26-17(16)18-13(5)21-23-27-18/h7-11H,6H2,1-5H3,(H,20,25)

Standard InChI Key:  DRMCOLZWTPQOAS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   29.9371  -28.0634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9310  -28.8847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7099  -29.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2011  -28.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7198  -27.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9313  -27.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4173  -26.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8622  -25.7101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6511  -25.9215    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6938  -26.7372    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.0183  -28.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4321  -27.7870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4216  -29.2024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2388  -29.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6402  -29.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4566  -29.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8713  -29.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4636  -28.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6485  -28.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6884  -29.2275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.0927  -29.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9099  -29.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1013  -28.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9185  -28.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9546  -29.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6798  -30.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6013  -26.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  5  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  1  0
  4 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
  3 25  1  0
 21 26  1  0
  7 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4440900

    ---

Associated Targets(non-human)

Gata4 GATA4/NKX2-5 (206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.49Molecular Weight (Monoisotopic): 385.1572AlogP: 4.30#Rotatable Bonds: 6
Polar Surface Area: 84.15Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.58CX Basic pKa: 5.42CX LogP: 3.08CX LogD: 3.08
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.68Np Likeness Score: -2.09

References

1. Jumppanen M, Kinnunen SM, Välimäki MJ, Talman V, Auno S, Bruun T, Boije Af Gennäs G, Xhaard H, Aumüller IB, Ruskoaho H, Yli-Kauhaluoma J..  (2019)  Synthesis, Identification, and Structure-Activity Relationship Analysis of GATA4 and NKX2-5 Protein-Protein Interaction Modulators.,  62  (17): [PMID:31431011] [10.1021/acs.jmedchem.9b01086]

Source