The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((bis(2-chloroethyl)amino)(thiophen-2-yl)methyl)-1,4-dihydroxyanthracene-9,10-dione ID: ALA4440907
PubChem CID: 141750635
Max Phase: Preclinical
Molecular Formula: C23H19Cl2NO4S
Molecular Weight: 476.38
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccccc2C(=O)c2c(O)c(C(c3ccsc3)N(CCCl)CCCl)cc(O)c21
Standard InChI: InChI=1S/C23H19Cl2NO4S/c24-6-8-26(9-7-25)20(13-5-10-31-12-13)16-11-17(27)18-19(23(16)30)22(29)15-4-2-1-3-14(15)21(18)28/h1-5,10-12,20,27,30H,6-9H2
Standard InChI Key: IJBUOJARHXEQRU-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
17.4123 -5.6378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4123 -4.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7070 -5.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7096 -4.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0058 -4.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2991 -4.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3005 -5.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0048 -5.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1176 -4.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1160 -5.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8202 -5.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5265 -5.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5241 -4.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8193 -4.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4109 -3.1862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4135 -6.4550 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8195 -6.4560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8174 -3.1926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2305 -4.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2279 -3.1853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9360 -4.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9343 -2.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5189 -2.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5163 -1.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8073 -1.5555 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.9317 -1.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6381 -1.5464 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.0224 -5.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8186 -5.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2240 -4.6759 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.6782 -4.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 1 1 0
1 10 1 0
9 2 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
2 15 2 0
1 16 2 0
11 17 1 0
14 18 1 0
13 19 1 0
19 20 1 0
19 21 1 0
20 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
22 26 1 0
26 27 1 0
21 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 21 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.38Molecular Weight (Monoisotopic): 475.0412AlogP: 4.80#Rotatable Bonds: 7Polar Surface Area: 77.84Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.85CX Basic pKa: 3.82CX LogP: 6.45CX LogD: 6.31Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.30Np Likeness Score: -0.05
References 1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X.. (2019) Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents., 29 (9): [PMID:30846253 ] [10.1016/j.bmcl.2019.02.026 ]