The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Chloro-N-(2-(5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl)phenyl)pyridine-3-sulfonamide ID: ALA4441313
PubChem CID: 155515127
Max Phase: Preclinical
Molecular Formula: C22H12ClF3N2O4S2
Molecular Weight: 524.93
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(-c2ccccc2NS(=O)(=O)c2ccc(Cl)nc2)s1)c1cc(F)c(F)c(O)c1F
Standard InChI: InChI=1S/C22H12ClF3N2O4S2/c23-18-8-5-11(10-27-18)34(31,32)28-15-4-2-1-3-12(15)16-6-7-17(33-16)21(29)13-9-14(24)20(26)22(30)19(13)25/h1-10,28,30H
Standard InChI Key: ZDKXTKFNOBVVDR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
8.0398 -4.2180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3341 -4.6308 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.0444 -5.0356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3464 -7.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1618 -7.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5687 -6.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1614 -6.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3428 -6.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9396 -6.7536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1201 -6.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6378 -6.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8613 -6.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8638 -7.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -7.4227 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.2041 -7.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4566 -7.3249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2920 -8.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -8.9470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7196 -9.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4677 -10.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1292 -9.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0384 -8.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8851 -8.6156 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.0597 -10.2407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5567 -10.9019 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.8780 -9.9300 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.9316 -5.3424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9262 -3.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3343 -3.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9271 -2.5212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1129 -2.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7075 -3.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1170 -3.9325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7022 -1.8156 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 1 0
9 10 1 0
13 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
18 23 1 0
19 24 1 0
20 25 1 0
21 26 1 0
8 27 1 0
27 2 1 0
2 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.93Molecular Weight (Monoisotopic): 523.9879AlogP: 5.62#Rotatable Bonds: 6Polar Surface Area: 96.36Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.10CX Basic pKa: ┄CX LogP: 5.21CX LogD: 3.54Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.19Np Likeness Score: -1.45
References 1. Abdelsamie AS, Salah M, Siebenbürger L, Merabet A, Scheuer C, Frotscher M, Müller ST, Zierau O, Vollmer G, Menger MD, Laschke MW, van Koppen CJ, Marchais-Oberwinkler S, Hartmann RW.. (2019) Design, Synthesis, and Biological Characterization of Orally Active 17β-Hydroxysteroid Dehydrogenase Type 2 Inhibitors Targeting the Prevention of Osteoporosis., 62 (15): [PMID:31343176 ] [10.1021/acs.jmedchem.9b00932 ]