The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(2-oxo-3-(2-(2-(pyridin-2-yl)ethylidene)hydrazinyl)propylthio)-5H-[1,2,4]triazino[5,6-b]indol-5-yl)-N'-(pyridin-2-ylmethylene)acetohydrazide ID: ALA4441936
PubChem CID: 155515682
Max Phase: Preclinical
Molecular Formula: C27H24N10O2S
Molecular Weight: 552.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CN/N=C/Cc1ccccn1)CSc1nnc2c3ccccc3n(CC(=O)N/N=C/c3ccccn3)c2n1
Standard InChI: InChI=1S/C27H24N10O2S/c38-21(16-31-30-14-11-19-7-3-5-12-28-19)18-40-27-33-26-25(35-36-27)22-9-1-2-10-23(22)37(26)17-24(39)34-32-15-20-8-4-6-13-29-20/h1-10,12-15,31H,11,16-18H2,(H,34,39)/b30-14+,32-15+
Standard InChI Key: XFLPKBOMELDHRY-AOIOOZFWSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
19.6993 -4.9815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0363 -4.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2925 -3.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7471 -3.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9454 -3.2844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6920 -4.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2391 -4.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1079 -3.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3604 -4.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1594 -4.6707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7066 -4.0622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4493 -3.2818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6509 -3.1163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7007 -5.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4091 -6.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4105 -7.0233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1161 -5.7963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1189 -7.4306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8259 -7.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5343 -7.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5223 -4.0612 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.9300 -3.3530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7472 -3.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1549 -2.6437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1567 -4.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9739 -4.0581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3833 -4.7653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.2005 -4.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6100 -5.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4272 -5.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5333 -8.2432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2409 -8.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9489 -8.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9448 -7.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2367 -7.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8324 -6.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6488 -6.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0573 -5.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6434 -4.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8284 -4.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
8 3 1 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
11 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
20 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 20 1 0
30 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.62Molecular Weight (Monoisotopic): 552.1804AlogP: 2.40#Rotatable Bonds: 12Polar Surface Area: 152.30Molecular Species: NEUTRALHBA: 12HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.61CX Basic pKa: 3.45CX LogP: 2.50CX LogD: 2.50Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.13Np Likeness Score: -1.79
References 1. Liu H, Long S, Rakesh KP, Zha GF.. (2020) Structure-activity relationships (SAR) of triazine derivatives: Promising antimicrobial agents., 185 [PMID:31675510 ] [10.1016/j.ejmech.2019.111804 ]