(2S,3S)-2-acetamido-N-((S)-1-((S)-1-amino-1-oxopropan-2-ylamino)-1-oxo-3-phenylpropan-2-yl)-3-methylpentanamide

ID: ALA4442410

PubChem CID: 101137783

Max Phase: Preclinical

Molecular Formula: C20H30N4O4

Molecular Weight: 390.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(N)=O

Standard InChI:  InChI=1S/C20H30N4O4/c1-5-12(2)17(23-14(4)25)20(28)24-16(11-15-9-7-6-8-10-15)19(27)22-13(3)18(21)26/h6-10,12-13,16-17H,5,11H2,1-4H3,(H2,21,26)(H,22,27)(H,23,25)(H,24,28)/t12-,13-,16-,17-/m0/s1

Standard InChI Key:  DDMGTSYQYDHCGY-PYTWLRIVSA-N

Molfile:  

 
     RDKit          2D

 28 28  0  0  0  0  0  0  0  0999 V2000
   21.9016  -19.1914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3102  -19.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5360  -19.1914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1274  -19.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9016  -20.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0844  -20.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3102  -21.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9016  -22.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5360  -20.6061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3532  -20.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3532  -19.1914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7618  -19.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7618  -21.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9876  -22.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5790  -21.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9876  -20.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8047  -20.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2133  -21.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8047  -22.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5790  -19.9009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9876  -19.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2133  -19.9009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5790  -18.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8047  -19.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2133  -18.4820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0844  -19.1914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6758  -19.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6758  -18.4820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  9  1  0
 12 20  1  0
 24 25  1  0
  2  1  1  6
  2  4  1  0
  4  3  2  0
  2  5  1  0
  5  6  1  6
  5  7  1  0
  7  8  1  0
  9 10  1  0
 10 12  1  0
 12 11  2  0
 10 13  1  6
 13 15  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  1  0
 21 24  1  0
 24 22  2  0
 21 23  1  1
  1 26  1  0
 26 27  1  0
 26 28  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.48Molecular Weight (Monoisotopic): 390.2267AlogP: 0.25#Rotatable Bonds: 10
Polar Surface Area: 130.39Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.21CX Basic pKa: CX LogP: 0.35CX LogD: 0.35
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.46Np Likeness Score: -0.20

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source