4-amino-1-phenyl-5-(trifluoromethyl)pyrimidin-2(1H)-one

ID: ALA4442829

PubChem CID: 155144682

Max Phase: Preclinical

Molecular Formula: C11H8F3N3O

Molecular Weight: 255.20

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(=O)n(-c2ccccc2)cc1C(F)(F)F

Standard InChI:  InChI=1S/C11H8F3N3O/c12-11(13,14)8-6-17(10(18)16-9(8)15)7-4-2-1-3-5-7/h1-6H,(H2,15,16,18)

Standard InChI Key:  NSPDUUKHXXLHDX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   13.2040   -3.8958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2040   -4.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9161   -5.1291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6280   -4.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6280   -3.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9161   -3.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9156   -5.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1995   -6.3652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1991   -7.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9142   -7.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6309   -7.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6278   -6.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9161   -2.6541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4902   -5.1343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3445   -3.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0549   -2.9889    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.1495   -3.7909    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.3554   -2.5939    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
  6 13  1  0
  2 14  2  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
  5 15  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4442829

    ---

Associated Targets(Human)

TET2 Tchem Methylcytosine dioxygenase TET2 (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TET1 Tbio Methylcytosine dioxygenase TET1 (33 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 255.20Molecular Weight (Monoisotopic): 255.0619AlogP: 1.83#Rotatable Bonds: 1
Polar Surface Area: 60.91Molecular Species: HBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.40CX LogD: 1.40
Aromatic Rings: 2Heavy Atoms: 18QED Weighted: 0.85Np Likeness Score: -1.07

References

1. Chua GNL, Wassarman KL, Sun H, Alp JA, Jarczyk EI, Kuzio NJ, Bennett MJ, Malachowsky BG, Kruse M, Kennedy AJ..  (2019)  Cytosine-Based TET Enzyme Inhibitors.,  10  (2): [PMID:30783500] [10.1021/acsmedchemlett.8b00474]

Source