The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-Methyl-1H-indol-3-yl)-N-(3-(2-propylhydrazinecarbonyl)-benzyl)ethanaminium 2,2,2-Trifluoroacetate ID: ALA4443074
PubChem CID: 155516139
Max Phase: Preclinical
Molecular Formula: C24H29F3N4O3
Molecular Weight: 364.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCNNC(=O)c1cccc(CNCCc2c(C)[nH]c3ccccc23)c1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C22H28N4O.C2HF3O2/c1-3-12-24-26-22(27)18-8-6-7-17(14-18)15-23-13-11-19-16(2)25-21-10-5-4-9-20(19)21;3-2(4,5)1(6)7/h4-10,14,23-25H,3,11-13,15H2,1-2H3,(H,26,27);(H,6,7)
Standard InChI Key: ZOMRKQFCDNFUKK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
27.0416 -26.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7534 -25.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4653 -26.3111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7534 -25.0812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3298 -25.9025 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.0416 -27.1324 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.3276 -26.7197 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.7042 -22.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7030 -22.9745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4152 -23.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1290 -22.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1262 -22.1472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4134 -21.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9909 -23.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2835 -22.9733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5713 -23.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8598 -22.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1477 -23.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2562 -24.3699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0597 -24.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6702 -24.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8440 -23.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3949 -23.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1444 -22.2753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3434 -22.1050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7933 -22.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0467 -23.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8368 -23.3824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8371 -24.1996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5444 -22.9736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2522 -23.3819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9598 -22.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6677 -23.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3752 -22.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
9 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 23 1 0
22 19 1 0
19 20 1 0
20 18 2 0
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
11 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 364.49Molecular Weight (Monoisotopic): 364.2263AlogP: 3.45#Rotatable Bonds: 9Polar Surface Area: 68.95Molecular Species: BASEHBA: 3HBD: 4#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.20CX LogP: 3.50CX LogD: 1.71Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.35Np Likeness Score: -1.13
References 1. Li X, Jiang Y, Peterson YK, Xu T, Himes RA, Luo X, Yin G, Inks ES, Dolloff N, Halene S, Chan SSL, Chou CJ.. (2020) Design of Hydrazide-Bearing HDACIs Based on Panobinostat and Their p53 and FLT3-ITD Dependency in Antileukemia Activity., 63 (10): [PMID:32321249 ] [10.1021/acs.jmedchem.0c00442 ]