The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[(3S,4R)-3-{[(3S)-1-(Cyclohex-1-en-1-ylmethyl)pyrrolidin-3-yl]carbamoyl}-1-[(2,6-dichlorophenyl)methyl]-4-methylpyrrolidin-3-yl]acetic acid ID: ALA4443425
PubChem CID: 71293710
Max Phase: Preclinical
Molecular Formula: C26H35Cl2N3O3
Molecular Weight: 508.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1CN(Cc2c(Cl)cccc2Cl)C[C@@]1(CC(=O)O)C(=O)N[C@H]1CCN(CC2=CCCCC2)C1
Standard InChI: InChI=1S/C26H35Cl2N3O3/c1-18-13-31(16-21-22(27)8-5-9-23(21)28)17-26(18,12-24(32)33)25(34)29-20-10-11-30(15-20)14-19-6-3-2-4-7-19/h5-6,8-9,18,20H,2-4,7,10-17H2,1H3,(H,29,34)(H,32,33)/t18-,20-,26+/m0/s1
Standard InChI Key: OYZBJRPMFFOVPU-STTRJGPESA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
27.2011 -11.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5093 -11.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7768 -11.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0852 -11.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3494 -11.6128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2179 -10.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4036 -10.6702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0283 -11.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2165 -11.5374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6987 -10.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9976 -10.1256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8833 -11.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7071 -10.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3098 -9.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1380 -9.6910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1338 -8.8519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0611 -10.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6151 -10.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7621 -11.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3993 -12.2617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0957 -11.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3543 -13.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6214 -13.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5728 -14.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8342 -14.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1477 -14.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1905 -13.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9291 -13.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9742 -12.1820 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.2628 -14.7332 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.6134 -11.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7270 -10.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4187 -10.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1544 -10.6303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
5 6 1 0
7 6 1 0
8 7 1 0
8 9 1 1
10 9 1 0
10 11 2 0
12 10 1 6
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
12 17 1 0
17 18 1 6
17 19 1 0
20 19 1 0
20 21 1 0
21 12 1 0
20 22 1 0
22 23 1 0
23 24 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
28 29 1 0
23 28 1 0
24 30 1 0
31 8 1 0
5 31 1 0
3 32 2 0
32 33 1 0
33 34 1 0
34 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.49Molecular Weight (Monoisotopic): 507.2055AlogP: 4.60#Rotatable Bonds: 8Polar Surface Area: 72.88Molecular Species: ZWITTERIONHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.88CX Basic pKa: 8.63CX LogP: 1.05CX LogD: 0.68Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -0.63
References 1. (2014) Pyrrolidine-3-ylacetic acid derivative,