The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-N-methyl-N-[6-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]propanamide ID: ALA4443742
PubChem CID: 155516707
Max Phase: Preclinical
Molecular Formula: C26H30F3N5O
Molecular Weight: 485.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2c(c1)C1CN(C)CCC1N2CCC(=O)N(C)c1c(C(F)(F)F)nc2ccc(C)cn12
Standard InChI: InChI=1S/C26H30F3N5O/c1-16-5-7-20-18(13-16)19-15-31(3)11-9-21(19)33(20)12-10-23(35)32(4)25-24(26(27,28)29)30-22-8-6-17(2)14-34(22)25/h5-8,13-14,19,21H,9-12,15H2,1-4H3
Standard InChI Key: PHQVPFUAQROCMD-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
16.2326 -13.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9406 -12.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6489 -13.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6489 -13.8767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9431 -14.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2326 -13.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5245 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4275 -14.1310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9090 -13.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4275 -12.8030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7284 -13.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1361 -12.7569 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.1361 -14.1772 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.5479 -13.4691 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.6396 -14.9188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4274 -15.1309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0597 -15.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2718 -16.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6919 -16.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9040 -17.6584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6699 -17.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6252 -18.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8338 -18.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3908 -18.2949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5685 -18.3402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2009 -19.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6471 -19.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4647 -19.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2394 -20.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3133 -19.2183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0419 -18.8440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0866 -18.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3985 -17.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7500 -19.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2677 -15.2866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
4 8 1 0
9 8 2 0
10 9 1 0
3 10 2 0
9 11 1 0
11 12 1 0
11 13 1 0
11 14 1 0
8 15 1 0
15 16 1 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 20 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 20 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
23 28 1 0
27 29 1 0
22 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
21 33 1 0
31 34 1 0
17 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.55Molecular Weight (Monoisotopic): 485.2402AlogP: 4.63#Rotatable Bonds: 4Polar Surface Area: 44.09Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.78CX LogP: 3.93CX LogD: 2.53Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: -1.36
References 1. Vanda D, Zajdel P, Soural M.. (2019) Imidazopyridine-based selective and multifunctional ligands of biological targets associated with psychiatric and neurodegenerative diseases., 181 [PMID:31404862 ] [10.1016/j.ejmech.2019.111569 ]